mirror of
https://github.com/openjdk/jdk.git
synced 2026-03-23 22:29:55 +00:00
3791 lines
140 KiB
C++
3791 lines
140 KiB
C++
/*
|
|
* Copyright 1999-2010 Sun Microsystems, Inc. All Rights Reserved.
|
|
* DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER.
|
|
*
|
|
* This code is free software; you can redistribute it and/or modify it
|
|
* under the terms of the GNU General Public License version 2 only, as
|
|
* published by the Free Software Foundation.
|
|
*
|
|
* This code is distributed in the hope that it will be useful, but WITHOUT
|
|
* ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
|
|
* FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
|
|
* version 2 for more details (a copy is included in the LICENSE file that
|
|
* accompanied this code).
|
|
*
|
|
* You should have received a copy of the GNU General Public License version
|
|
* 2 along with this work; if not, write to the Free Software Foundation,
|
|
* Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA.
|
|
*
|
|
* Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara,
|
|
* CA 95054 USA or visit www.sun.com if you need additional information or
|
|
* have any questions.
|
|
*
|
|
*/
|
|
|
|
#include "incls/_precompiled.incl"
|
|
#include "incls/_c1_GraphBuilder.cpp.incl"
|
|
|
|
class BlockListBuilder VALUE_OBJ_CLASS_SPEC {
|
|
private:
|
|
Compilation* _compilation;
|
|
IRScope* _scope;
|
|
|
|
BlockList _blocks; // internal list of all blocks
|
|
BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder
|
|
|
|
// fields used by mark_loops
|
|
BitMap _active; // for iteration of control flow graph
|
|
BitMap _visited; // for iteration of control flow graph
|
|
intArray _loop_map; // caches the information if a block is contained in a loop
|
|
int _next_loop_index; // next free loop number
|
|
int _next_block_number; // for reverse postorder numbering of blocks
|
|
|
|
// accessors
|
|
Compilation* compilation() const { return _compilation; }
|
|
IRScope* scope() const { return _scope; }
|
|
ciMethod* method() const { return scope()->method(); }
|
|
XHandlers* xhandlers() const { return scope()->xhandlers(); }
|
|
|
|
// unified bailout support
|
|
void bailout(const char* msg) const { compilation()->bailout(msg); }
|
|
bool bailed_out() const { return compilation()->bailed_out(); }
|
|
|
|
// helper functions
|
|
BlockBegin* make_block_at(int bci, BlockBegin* predecessor);
|
|
void handle_exceptions(BlockBegin* current, int cur_bci);
|
|
void handle_jsr(BlockBegin* current, int sr_bci, int next_bci);
|
|
void store_one(BlockBegin* current, int local);
|
|
void store_two(BlockBegin* current, int local);
|
|
void set_entries(int osr_bci);
|
|
void set_leaders();
|
|
|
|
void make_loop_header(BlockBegin* block);
|
|
void mark_loops();
|
|
int mark_loops(BlockBegin* b, bool in_subroutine);
|
|
|
|
// debugging
|
|
#ifndef PRODUCT
|
|
void print();
|
|
#endif
|
|
|
|
public:
|
|
// creation
|
|
BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci);
|
|
|
|
// accessors for GraphBuilder
|
|
BlockList* bci2block() const { return _bci2block; }
|
|
};
|
|
|
|
|
|
// Implementation of BlockListBuilder
|
|
|
|
BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci)
|
|
: _compilation(compilation)
|
|
, _scope(scope)
|
|
, _blocks(16)
|
|
, _bci2block(new BlockList(scope->method()->code_size(), NULL))
|
|
, _next_block_number(0)
|
|
, _active() // size not known yet
|
|
, _visited() // size not known yet
|
|
, _next_loop_index(0)
|
|
, _loop_map() // size not known yet
|
|
{
|
|
set_entries(osr_bci);
|
|
set_leaders();
|
|
CHECK_BAILOUT();
|
|
|
|
mark_loops();
|
|
NOT_PRODUCT(if (PrintInitialBlockList) print());
|
|
|
|
#ifndef PRODUCT
|
|
if (PrintCFGToFile) {
|
|
stringStream title;
|
|
title.print("BlockListBuilder ");
|
|
scope->method()->print_name(&title);
|
|
CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false);
|
|
}
|
|
#endif
|
|
}
|
|
|
|
|
|
void BlockListBuilder::set_entries(int osr_bci) {
|
|
// generate start blocks
|
|
BlockBegin* std_entry = make_block_at(0, NULL);
|
|
if (scope()->caller() == NULL) {
|
|
std_entry->set(BlockBegin::std_entry_flag);
|
|
}
|
|
if (osr_bci != -1) {
|
|
BlockBegin* osr_entry = make_block_at(osr_bci, NULL);
|
|
osr_entry->set(BlockBegin::osr_entry_flag);
|
|
}
|
|
|
|
// generate exception entry blocks
|
|
XHandlers* list = xhandlers();
|
|
const int n = list->length();
|
|
for (int i = 0; i < n; i++) {
|
|
XHandler* h = list->handler_at(i);
|
|
BlockBegin* entry = make_block_at(h->handler_bci(), NULL);
|
|
entry->set(BlockBegin::exception_entry_flag);
|
|
h->set_entry_block(entry);
|
|
}
|
|
}
|
|
|
|
|
|
BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) {
|
|
assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer");
|
|
|
|
BlockBegin* block = _bci2block->at(cur_bci);
|
|
if (block == NULL) {
|
|
block = new BlockBegin(cur_bci);
|
|
block->init_stores_to_locals(method()->max_locals());
|
|
_bci2block->at_put(cur_bci, block);
|
|
_blocks.append(block);
|
|
|
|
assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist");
|
|
}
|
|
|
|
if (predecessor != NULL) {
|
|
if (block->is_set(BlockBegin::exception_entry_flag)) {
|
|
BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block);
|
|
}
|
|
|
|
predecessor->add_successor(block);
|
|
block->increment_total_preds();
|
|
}
|
|
|
|
return block;
|
|
}
|
|
|
|
|
|
inline void BlockListBuilder::store_one(BlockBegin* current, int local) {
|
|
current->stores_to_locals().set_bit(local);
|
|
}
|
|
inline void BlockListBuilder::store_two(BlockBegin* current, int local) {
|
|
store_one(current, local);
|
|
store_one(current, local + 1);
|
|
}
|
|
|
|
|
|
void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) {
|
|
// Draws edges from a block to its exception handlers
|
|
XHandlers* list = xhandlers();
|
|
const int n = list->length();
|
|
|
|
for (int i = 0; i < n; i++) {
|
|
XHandler* h = list->handler_at(i);
|
|
|
|
if (h->covers(cur_bci)) {
|
|
BlockBegin* entry = h->entry_block();
|
|
assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set");
|
|
assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set");
|
|
|
|
// add each exception handler only once
|
|
if (!current->is_successor(entry)) {
|
|
current->add_successor(entry);
|
|
entry->increment_total_preds();
|
|
}
|
|
|
|
// stop when reaching catchall
|
|
if (h->catch_type() == 0) break;
|
|
}
|
|
}
|
|
}
|
|
|
|
void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) {
|
|
// start a new block after jsr-bytecode and link this block into cfg
|
|
make_block_at(next_bci, current);
|
|
|
|
// start a new block at the subroutine entry at mark it with special flag
|
|
BlockBegin* sr_block = make_block_at(sr_bci, current);
|
|
if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) {
|
|
sr_block->set(BlockBegin::subroutine_entry_flag);
|
|
}
|
|
}
|
|
|
|
|
|
void BlockListBuilder::set_leaders() {
|
|
bool has_xhandlers = xhandlers()->has_handlers();
|
|
BlockBegin* current = NULL;
|
|
|
|
// The information which bci starts a new block simplifies the analysis
|
|
// Without it, backward branches could jump to a bci where no block was created
|
|
// during bytecode iteration. This would require the creation of a new block at the
|
|
// branch target and a modification of the successor lists.
|
|
BitMap bci_block_start = method()->bci_block_start();
|
|
|
|
ciBytecodeStream s(method());
|
|
while (s.next() != ciBytecodeStream::EOBC()) {
|
|
int cur_bci = s.cur_bci();
|
|
|
|
if (bci_block_start.at(cur_bci)) {
|
|
current = make_block_at(cur_bci, current);
|
|
}
|
|
assert(current != NULL, "must have current block");
|
|
|
|
if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) {
|
|
handle_exceptions(current, cur_bci);
|
|
}
|
|
|
|
switch (s.cur_bc()) {
|
|
// track stores to local variables for selective creation of phi functions
|
|
case Bytecodes::_iinc: store_one(current, s.get_index()); break;
|
|
case Bytecodes::_istore: store_one(current, s.get_index()); break;
|
|
case Bytecodes::_lstore: store_two(current, s.get_index()); break;
|
|
case Bytecodes::_fstore: store_one(current, s.get_index()); break;
|
|
case Bytecodes::_dstore: store_two(current, s.get_index()); break;
|
|
case Bytecodes::_astore: store_one(current, s.get_index()); break;
|
|
case Bytecodes::_istore_0: store_one(current, 0); break;
|
|
case Bytecodes::_istore_1: store_one(current, 1); break;
|
|
case Bytecodes::_istore_2: store_one(current, 2); break;
|
|
case Bytecodes::_istore_3: store_one(current, 3); break;
|
|
case Bytecodes::_lstore_0: store_two(current, 0); break;
|
|
case Bytecodes::_lstore_1: store_two(current, 1); break;
|
|
case Bytecodes::_lstore_2: store_two(current, 2); break;
|
|
case Bytecodes::_lstore_3: store_two(current, 3); break;
|
|
case Bytecodes::_fstore_0: store_one(current, 0); break;
|
|
case Bytecodes::_fstore_1: store_one(current, 1); break;
|
|
case Bytecodes::_fstore_2: store_one(current, 2); break;
|
|
case Bytecodes::_fstore_3: store_one(current, 3); break;
|
|
case Bytecodes::_dstore_0: store_two(current, 0); break;
|
|
case Bytecodes::_dstore_1: store_two(current, 1); break;
|
|
case Bytecodes::_dstore_2: store_two(current, 2); break;
|
|
case Bytecodes::_dstore_3: store_two(current, 3); break;
|
|
case Bytecodes::_astore_0: store_one(current, 0); break;
|
|
case Bytecodes::_astore_1: store_one(current, 1); break;
|
|
case Bytecodes::_astore_2: store_one(current, 2); break;
|
|
case Bytecodes::_astore_3: store_one(current, 3); break;
|
|
|
|
// track bytecodes that affect the control flow
|
|
case Bytecodes::_athrow: // fall through
|
|
case Bytecodes::_ret: // fall through
|
|
case Bytecodes::_ireturn: // fall through
|
|
case Bytecodes::_lreturn: // fall through
|
|
case Bytecodes::_freturn: // fall through
|
|
case Bytecodes::_dreturn: // fall through
|
|
case Bytecodes::_areturn: // fall through
|
|
case Bytecodes::_return:
|
|
current = NULL;
|
|
break;
|
|
|
|
case Bytecodes::_ifeq: // fall through
|
|
case Bytecodes::_ifne: // fall through
|
|
case Bytecodes::_iflt: // fall through
|
|
case Bytecodes::_ifge: // fall through
|
|
case Bytecodes::_ifgt: // fall through
|
|
case Bytecodes::_ifle: // fall through
|
|
case Bytecodes::_if_icmpeq: // fall through
|
|
case Bytecodes::_if_icmpne: // fall through
|
|
case Bytecodes::_if_icmplt: // fall through
|
|
case Bytecodes::_if_icmpge: // fall through
|
|
case Bytecodes::_if_icmpgt: // fall through
|
|
case Bytecodes::_if_icmple: // fall through
|
|
case Bytecodes::_if_acmpeq: // fall through
|
|
case Bytecodes::_if_acmpne: // fall through
|
|
case Bytecodes::_ifnull: // fall through
|
|
case Bytecodes::_ifnonnull:
|
|
make_block_at(s.next_bci(), current);
|
|
make_block_at(s.get_dest(), current);
|
|
current = NULL;
|
|
break;
|
|
|
|
case Bytecodes::_goto:
|
|
make_block_at(s.get_dest(), current);
|
|
current = NULL;
|
|
break;
|
|
|
|
case Bytecodes::_goto_w:
|
|
make_block_at(s.get_far_dest(), current);
|
|
current = NULL;
|
|
break;
|
|
|
|
case Bytecodes::_jsr:
|
|
handle_jsr(current, s.get_dest(), s.next_bci());
|
|
current = NULL;
|
|
break;
|
|
|
|
case Bytecodes::_jsr_w:
|
|
handle_jsr(current, s.get_far_dest(), s.next_bci());
|
|
current = NULL;
|
|
break;
|
|
|
|
case Bytecodes::_tableswitch: {
|
|
// set block for each case
|
|
Bytecode_tableswitch *switch_ = Bytecode_tableswitch_at(s.cur_bcp());
|
|
int l = switch_->length();
|
|
for (int i = 0; i < l; i++) {
|
|
make_block_at(cur_bci + switch_->dest_offset_at(i), current);
|
|
}
|
|
make_block_at(cur_bci + switch_->default_offset(), current);
|
|
current = NULL;
|
|
break;
|
|
}
|
|
|
|
case Bytecodes::_lookupswitch: {
|
|
// set block for each case
|
|
Bytecode_lookupswitch *switch_ = Bytecode_lookupswitch_at(s.cur_bcp());
|
|
int l = switch_->number_of_pairs();
|
|
for (int i = 0; i < l; i++) {
|
|
make_block_at(cur_bci + switch_->pair_at(i)->offset(), current);
|
|
}
|
|
make_block_at(cur_bci + switch_->default_offset(), current);
|
|
current = NULL;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
void BlockListBuilder::mark_loops() {
|
|
ResourceMark rm;
|
|
|
|
_active = BitMap(BlockBegin::number_of_blocks()); _active.clear();
|
|
_visited = BitMap(BlockBegin::number_of_blocks()); _visited.clear();
|
|
_loop_map = intArray(BlockBegin::number_of_blocks(), 0);
|
|
_next_loop_index = 0;
|
|
_next_block_number = _blocks.length();
|
|
|
|
// recursively iterate the control flow graph
|
|
mark_loops(_bci2block->at(0), false);
|
|
assert(_next_block_number >= 0, "invalid block numbers");
|
|
}
|
|
|
|
void BlockListBuilder::make_loop_header(BlockBegin* block) {
|
|
if (block->is_set(BlockBegin::exception_entry_flag)) {
|
|
// exception edges may look like loops but don't mark them as such
|
|
// since it screws up block ordering.
|
|
return;
|
|
}
|
|
if (!block->is_set(BlockBegin::parser_loop_header_flag)) {
|
|
block->set(BlockBegin::parser_loop_header_flag);
|
|
|
|
assert(_loop_map.at(block->block_id()) == 0, "must not be set yet");
|
|
assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer");
|
|
_loop_map.at_put(block->block_id(), 1 << _next_loop_index);
|
|
if (_next_loop_index < 31) _next_loop_index++;
|
|
} else {
|
|
// block already marked as loop header
|
|
assert(is_power_of_2((unsigned int)_loop_map.at(block->block_id())), "exactly one bit must be set");
|
|
}
|
|
}
|
|
|
|
int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) {
|
|
int block_id = block->block_id();
|
|
|
|
if (_visited.at(block_id)) {
|
|
if (_active.at(block_id)) {
|
|
// reached block via backward branch
|
|
make_loop_header(block);
|
|
}
|
|
// return cached loop information for this block
|
|
return _loop_map.at(block_id);
|
|
}
|
|
|
|
if (block->is_set(BlockBegin::subroutine_entry_flag)) {
|
|
in_subroutine = true;
|
|
}
|
|
|
|
// set active and visited bits before successors are processed
|
|
_visited.set_bit(block_id);
|
|
_active.set_bit(block_id);
|
|
|
|
intptr_t loop_state = 0;
|
|
for (int i = block->number_of_sux() - 1; i >= 0; i--) {
|
|
// recursively process all successors
|
|
loop_state |= mark_loops(block->sux_at(i), in_subroutine);
|
|
}
|
|
|
|
// clear active-bit after all successors are processed
|
|
_active.clear_bit(block_id);
|
|
|
|
// reverse-post-order numbering of all blocks
|
|
block->set_depth_first_number(_next_block_number);
|
|
_next_block_number--;
|
|
|
|
if (loop_state != 0 || in_subroutine ) {
|
|
// block is contained at least in one loop, so phi functions are necessary
|
|
// phi functions are also necessary for all locals stored in a subroutine
|
|
scope()->requires_phi_function().set_union(block->stores_to_locals());
|
|
}
|
|
|
|
if (block->is_set(BlockBegin::parser_loop_header_flag)) {
|
|
int header_loop_state = _loop_map.at(block_id);
|
|
assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set");
|
|
|
|
// If the highest bit is set (i.e. when integer value is negative), the method
|
|
// has 32 or more loops. This bit is never cleared because it is used for multiple loops
|
|
if (header_loop_state >= 0) {
|
|
clear_bits(loop_state, header_loop_state);
|
|
}
|
|
}
|
|
|
|
// cache and return loop information for this block
|
|
_loop_map.at_put(block_id, loop_state);
|
|
return loop_state;
|
|
}
|
|
|
|
|
|
#ifndef PRODUCT
|
|
|
|
int compare_depth_first(BlockBegin** a, BlockBegin** b) {
|
|
return (*a)->depth_first_number() - (*b)->depth_first_number();
|
|
}
|
|
|
|
void BlockListBuilder::print() {
|
|
tty->print("----- initial block list of BlockListBuilder for method ");
|
|
method()->print_short_name();
|
|
tty->cr();
|
|
|
|
// better readability if blocks are sorted in processing order
|
|
_blocks.sort(compare_depth_first);
|
|
|
|
for (int i = 0; i < _blocks.length(); i++) {
|
|
BlockBegin* cur = _blocks.at(i);
|
|
tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds());
|
|
|
|
tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " ");
|
|
tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " ");
|
|
tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " ");
|
|
tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " ");
|
|
tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " ");
|
|
|
|
if (cur->number_of_sux() > 0) {
|
|
tty->print(" sux: ");
|
|
for (int j = 0; j < cur->number_of_sux(); j++) {
|
|
BlockBegin* sux = cur->sux_at(j);
|
|
tty->print("B%d ", sux->block_id());
|
|
}
|
|
}
|
|
tty->cr();
|
|
}
|
|
}
|
|
|
|
#endif
|
|
|
|
|
|
// A simple growable array of Values indexed by ciFields
|
|
class FieldBuffer: public CompilationResourceObj {
|
|
private:
|
|
GrowableArray<Value> _values;
|
|
|
|
public:
|
|
FieldBuffer() {}
|
|
|
|
void kill() {
|
|
_values.trunc_to(0);
|
|
}
|
|
|
|
Value at(ciField* field) {
|
|
assert(field->holder()->is_loaded(), "must be a loaded field");
|
|
int offset = field->offset();
|
|
if (offset < _values.length()) {
|
|
return _values.at(offset);
|
|
} else {
|
|
return NULL;
|
|
}
|
|
}
|
|
|
|
void at_put(ciField* field, Value value) {
|
|
assert(field->holder()->is_loaded(), "must be a loaded field");
|
|
int offset = field->offset();
|
|
_values.at_put_grow(offset, value, NULL);
|
|
}
|
|
|
|
};
|
|
|
|
|
|
// MemoryBuffer is fairly simple model of the current state of memory.
|
|
// It partitions memory into several pieces. The first piece is
|
|
// generic memory where little is known about the owner of the memory.
|
|
// This is conceptually represented by the tuple <O, F, V> which says
|
|
// that the field F of object O has value V. This is flattened so
|
|
// that F is represented by the offset of the field and the parallel
|
|
// arrays _objects and _values are used for O and V. Loads of O.F can
|
|
// simply use V. Newly allocated objects are kept in a separate list
|
|
// along with a parallel array for each object which represents the
|
|
// current value of its fields. Stores of the default value to fields
|
|
// which have never been stored to before are eliminated since they
|
|
// are redundant. Once newly allocated objects are stored into
|
|
// another object or they are passed out of the current compile they
|
|
// are treated like generic memory.
|
|
|
|
class MemoryBuffer: public CompilationResourceObj {
|
|
private:
|
|
FieldBuffer _values;
|
|
GrowableArray<Value> _objects;
|
|
GrowableArray<Value> _newobjects;
|
|
GrowableArray<FieldBuffer*> _fields;
|
|
|
|
public:
|
|
MemoryBuffer() {}
|
|
|
|
StoreField* store(StoreField* st) {
|
|
if (!EliminateFieldAccess) {
|
|
return st;
|
|
}
|
|
|
|
Value object = st->obj();
|
|
Value value = st->value();
|
|
ciField* field = st->field();
|
|
if (field->holder()->is_loaded()) {
|
|
int offset = field->offset();
|
|
int index = _newobjects.find(object);
|
|
if (index != -1) {
|
|
// newly allocated object with no other stores performed on this field
|
|
FieldBuffer* buf = _fields.at(index);
|
|
if (buf->at(field) == NULL && is_default_value(value)) {
|
|
#ifndef PRODUCT
|
|
if (PrintIRDuringConstruction && Verbose) {
|
|
tty->print_cr("Eliminated store for object %d:", index);
|
|
st->print_line();
|
|
}
|
|
#endif
|
|
return NULL;
|
|
} else {
|
|
buf->at_put(field, value);
|
|
}
|
|
} else {
|
|
_objects.at_put_grow(offset, object, NULL);
|
|
_values.at_put(field, value);
|
|
}
|
|
|
|
store_value(value);
|
|
} else {
|
|
// if we held onto field names we could alias based on names but
|
|
// we don't know what's being stored to so kill it all.
|
|
kill();
|
|
}
|
|
return st;
|
|
}
|
|
|
|
|
|
// return true if this value correspond to the default value of a field.
|
|
bool is_default_value(Value value) {
|
|
Constant* con = value->as_Constant();
|
|
if (con) {
|
|
switch (con->type()->tag()) {
|
|
case intTag: return con->type()->as_IntConstant()->value() == 0;
|
|
case longTag: return con->type()->as_LongConstant()->value() == 0;
|
|
case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0;
|
|
case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0);
|
|
case objectTag: return con->type() == objectNull;
|
|
default: ShouldNotReachHere();
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
|
|
// return either the actual value of a load or the load itself
|
|
Value load(LoadField* load) {
|
|
if (!EliminateFieldAccess) {
|
|
return load;
|
|
}
|
|
|
|
if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) {
|
|
// can't skip load since value might get rounded as a side effect
|
|
return load;
|
|
}
|
|
|
|
ciField* field = load->field();
|
|
Value object = load->obj();
|
|
if (field->holder()->is_loaded() && !field->is_volatile()) {
|
|
int offset = field->offset();
|
|
Value result = NULL;
|
|
int index = _newobjects.find(object);
|
|
if (index != -1) {
|
|
result = _fields.at(index)->at(field);
|
|
} else if (_objects.at_grow(offset, NULL) == object) {
|
|
result = _values.at(field);
|
|
}
|
|
if (result != NULL) {
|
|
#ifndef PRODUCT
|
|
if (PrintIRDuringConstruction && Verbose) {
|
|
tty->print_cr("Eliminated load: ");
|
|
load->print_line();
|
|
}
|
|
#endif
|
|
assert(result->type()->tag() == load->type()->tag(), "wrong types");
|
|
return result;
|
|
}
|
|
}
|
|
return load;
|
|
}
|
|
|
|
// Record this newly allocated object
|
|
void new_instance(NewInstance* object) {
|
|
int index = _newobjects.length();
|
|
_newobjects.append(object);
|
|
if (_fields.at_grow(index, NULL) == NULL) {
|
|
_fields.at_put(index, new FieldBuffer());
|
|
} else {
|
|
_fields.at(index)->kill();
|
|
}
|
|
}
|
|
|
|
void store_value(Value value) {
|
|
int index = _newobjects.find(value);
|
|
if (index != -1) {
|
|
// stored a newly allocated object into another object.
|
|
// Assume we've lost track of it as separate slice of memory.
|
|
// We could do better by keeping track of whether individual
|
|
// fields could alias each other.
|
|
_newobjects.remove_at(index);
|
|
// pull out the field info and store it at the end up the list
|
|
// of field info list to be reused later.
|
|
_fields.append(_fields.at(index));
|
|
_fields.remove_at(index);
|
|
}
|
|
}
|
|
|
|
void kill() {
|
|
_newobjects.trunc_to(0);
|
|
_objects.trunc_to(0);
|
|
_values.kill();
|
|
}
|
|
};
|
|
|
|
|
|
// Implementation of GraphBuilder's ScopeData
|
|
|
|
GraphBuilder::ScopeData::ScopeData(ScopeData* parent)
|
|
: _parent(parent)
|
|
, _bci2block(NULL)
|
|
, _scope(NULL)
|
|
, _has_handler(false)
|
|
, _stream(NULL)
|
|
, _work_list(NULL)
|
|
, _parsing_jsr(false)
|
|
, _jsr_xhandlers(NULL)
|
|
, _caller_stack_size(-1)
|
|
, _continuation(NULL)
|
|
, _continuation_state(NULL)
|
|
, _num_returns(0)
|
|
, _cleanup_block(NULL)
|
|
, _cleanup_return_prev(NULL)
|
|
, _cleanup_state(NULL)
|
|
{
|
|
if (parent != NULL) {
|
|
_max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f);
|
|
} else {
|
|
_max_inline_size = MaxInlineSize;
|
|
}
|
|
if (_max_inline_size < MaxTrivialSize) {
|
|
_max_inline_size = MaxTrivialSize;
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::kill_all() {
|
|
if (UseLocalValueNumbering) {
|
|
vmap()->kill_all();
|
|
}
|
|
_memory->kill();
|
|
}
|
|
|
|
|
|
BlockBegin* GraphBuilder::ScopeData::block_at(int bci) {
|
|
if (parsing_jsr()) {
|
|
// It is necessary to clone all blocks associated with a
|
|
// subroutine, including those for exception handlers in the scope
|
|
// of the method containing the jsr (because those exception
|
|
// handlers may contain ret instructions in some cases).
|
|
BlockBegin* block = bci2block()->at(bci);
|
|
if (block != NULL && block == parent()->bci2block()->at(bci)) {
|
|
BlockBegin* new_block = new BlockBegin(block->bci());
|
|
#ifndef PRODUCT
|
|
if (PrintInitialBlockList) {
|
|
tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr",
|
|
block->block_id(), block->bci(), new_block->block_id());
|
|
}
|
|
#endif
|
|
// copy data from cloned blocked
|
|
new_block->set_depth_first_number(block->depth_first_number());
|
|
if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag);
|
|
// Preserve certain flags for assertion checking
|
|
if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag);
|
|
if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag);
|
|
|
|
// copy was_visited_flag to allow early detection of bailouts
|
|
// if a block that is used in a jsr has already been visited before,
|
|
// it is shared between the normal control flow and a subroutine
|
|
// BlockBegin::try_merge returns false when the flag is set, this leads
|
|
// to a compilation bailout
|
|
if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag);
|
|
|
|
bci2block()->at_put(bci, new_block);
|
|
block = new_block;
|
|
}
|
|
return block;
|
|
} else {
|
|
return bci2block()->at(bci);
|
|
}
|
|
}
|
|
|
|
|
|
XHandlers* GraphBuilder::ScopeData::xhandlers() const {
|
|
if (_jsr_xhandlers == NULL) {
|
|
assert(!parsing_jsr(), "");
|
|
return scope()->xhandlers();
|
|
}
|
|
assert(parsing_jsr(), "");
|
|
return _jsr_xhandlers;
|
|
}
|
|
|
|
|
|
void GraphBuilder::ScopeData::set_scope(IRScope* scope) {
|
|
_scope = scope;
|
|
bool parent_has_handler = false;
|
|
if (parent() != NULL) {
|
|
parent_has_handler = parent()->has_handler();
|
|
}
|
|
_has_handler = parent_has_handler || scope->xhandlers()->has_handlers();
|
|
}
|
|
|
|
|
|
void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block,
|
|
Instruction* return_prev,
|
|
ValueStack* return_state) {
|
|
_cleanup_block = block;
|
|
_cleanup_return_prev = return_prev;
|
|
_cleanup_state = return_state;
|
|
}
|
|
|
|
|
|
void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) {
|
|
if (_work_list == NULL) {
|
|
_work_list = new BlockList();
|
|
}
|
|
|
|
if (!block->is_set(BlockBegin::is_on_work_list_flag)) {
|
|
// Do not start parsing the continuation block while in a
|
|
// sub-scope
|
|
if (parsing_jsr()) {
|
|
if (block == jsr_continuation()) {
|
|
return;
|
|
}
|
|
} else {
|
|
if (block == continuation()) {
|
|
return;
|
|
}
|
|
}
|
|
block->set(BlockBegin::is_on_work_list_flag);
|
|
_work_list->push(block);
|
|
|
|
sort_top_into_worklist(_work_list, block);
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) {
|
|
assert(worklist->top() == top, "");
|
|
// sort block descending into work list
|
|
const int dfn = top->depth_first_number();
|
|
assert(dfn != -1, "unknown depth first number");
|
|
int i = worklist->length()-2;
|
|
while (i >= 0) {
|
|
BlockBegin* b = worklist->at(i);
|
|
if (b->depth_first_number() < dfn) {
|
|
worklist->at_put(i+1, b);
|
|
} else {
|
|
break;
|
|
}
|
|
i --;
|
|
}
|
|
if (i >= -1) worklist->at_put(i + 1, top);
|
|
}
|
|
|
|
int GraphBuilder::ScopeData::caller_stack_size() const {
|
|
ValueStack* state = scope()->caller_state();
|
|
if (state == NULL) {
|
|
return 0;
|
|
}
|
|
return state->stack_size();
|
|
}
|
|
|
|
|
|
BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() {
|
|
if (is_work_list_empty()) {
|
|
return NULL;
|
|
}
|
|
return _work_list->pop();
|
|
}
|
|
|
|
|
|
bool GraphBuilder::ScopeData::is_work_list_empty() const {
|
|
return (_work_list == NULL || _work_list->length() == 0);
|
|
}
|
|
|
|
|
|
void GraphBuilder::ScopeData::setup_jsr_xhandlers() {
|
|
assert(parsing_jsr(), "");
|
|
// clone all the exception handlers from the scope
|
|
XHandlers* handlers = new XHandlers(scope()->xhandlers());
|
|
const int n = handlers->length();
|
|
for (int i = 0; i < n; i++) {
|
|
// The XHandlers need to be adjusted to dispatch to the cloned
|
|
// handler block instead of the default one but the synthetic
|
|
// unlocker needs to be handled specially. The synthetic unlocker
|
|
// should be left alone since there can be only one and all code
|
|
// should dispatch to the same one.
|
|
XHandler* h = handlers->handler_at(i);
|
|
assert(h->handler_bci() != SynchronizationEntryBCI, "must be real");
|
|
h->set_entry_block(block_at(h->handler_bci()));
|
|
}
|
|
_jsr_xhandlers = handlers;
|
|
}
|
|
|
|
|
|
int GraphBuilder::ScopeData::num_returns() {
|
|
if (parsing_jsr()) {
|
|
return parent()->num_returns();
|
|
}
|
|
return _num_returns;
|
|
}
|
|
|
|
|
|
void GraphBuilder::ScopeData::incr_num_returns() {
|
|
if (parsing_jsr()) {
|
|
parent()->incr_num_returns();
|
|
} else {
|
|
++_num_returns;
|
|
}
|
|
}
|
|
|
|
|
|
// Implementation of GraphBuilder
|
|
|
|
#define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; }
|
|
|
|
|
|
void GraphBuilder::load_constant() {
|
|
ciConstant con = stream()->get_constant();
|
|
if (con.basic_type() == T_ILLEGAL) {
|
|
BAILOUT("could not resolve a constant");
|
|
} else {
|
|
ValueType* t = illegalType;
|
|
ValueStack* patch_state = NULL;
|
|
switch (con.basic_type()) {
|
|
case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break;
|
|
case T_BYTE : t = new IntConstant (con.as_byte ()); break;
|
|
case T_CHAR : t = new IntConstant (con.as_char ()); break;
|
|
case T_SHORT : t = new IntConstant (con.as_short ()); break;
|
|
case T_INT : t = new IntConstant (con.as_int ()); break;
|
|
case T_LONG : t = new LongConstant (con.as_long ()); break;
|
|
case T_FLOAT : t = new FloatConstant (con.as_float ()); break;
|
|
case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break;
|
|
case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break;
|
|
case T_OBJECT :
|
|
{
|
|
ciObject* obj = con.as_object();
|
|
if (obj->is_klass()) {
|
|
ciKlass* klass = obj->as_klass();
|
|
if (!klass->is_loaded() || PatchALot) {
|
|
patch_state = state()->copy();
|
|
t = new ObjectConstant(obj);
|
|
} else {
|
|
t = new InstanceConstant(klass->java_mirror());
|
|
}
|
|
} else {
|
|
t = new InstanceConstant(obj->as_instance());
|
|
}
|
|
break;
|
|
}
|
|
default : ShouldNotReachHere();
|
|
}
|
|
Value x;
|
|
if (patch_state != NULL) {
|
|
x = new Constant(t, patch_state);
|
|
} else {
|
|
x = new Constant(t);
|
|
}
|
|
push(t, append(x));
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::load_local(ValueType* type, int index) {
|
|
Value x = state()->load_local(index);
|
|
push(type, x);
|
|
}
|
|
|
|
|
|
void GraphBuilder::store_local(ValueType* type, int index) {
|
|
Value x = pop(type);
|
|
store_local(state(), x, type, index);
|
|
}
|
|
|
|
|
|
void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) {
|
|
if (parsing_jsr()) {
|
|
// We need to do additional tracking of the location of the return
|
|
// address for jsrs since we don't handle arbitrary jsr/ret
|
|
// constructs. Here we are figuring out in which circumstances we
|
|
// need to bail out.
|
|
if (x->type()->is_address()) {
|
|
scope_data()->set_jsr_return_address_local(index);
|
|
|
|
// Also check parent jsrs (if any) at this time to see whether
|
|
// they are using this local. We don't handle skipping over a
|
|
// ret.
|
|
for (ScopeData* cur_scope_data = scope_data()->parent();
|
|
cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope();
|
|
cur_scope_data = cur_scope_data->parent()) {
|
|
if (cur_scope_data->jsr_return_address_local() == index) {
|
|
BAILOUT("subroutine overwrites return address from previous subroutine");
|
|
}
|
|
}
|
|
} else if (index == scope_data()->jsr_return_address_local()) {
|
|
scope_data()->set_jsr_return_address_local(-1);
|
|
}
|
|
}
|
|
|
|
state->store_local(index, round_fp(x));
|
|
}
|
|
|
|
|
|
void GraphBuilder::load_indexed(BasicType type) {
|
|
Value index = ipop();
|
|
Value array = apop();
|
|
Value length = NULL;
|
|
if (CSEArrayLength ||
|
|
(array->as_AccessField() && array->as_AccessField()->field()->is_constant()) ||
|
|
(array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) {
|
|
length = append(new ArrayLength(array, lock_stack()));
|
|
}
|
|
push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, lock_stack())));
|
|
}
|
|
|
|
|
|
void GraphBuilder::store_indexed(BasicType type) {
|
|
Value value = pop(as_ValueType(type));
|
|
Value index = ipop();
|
|
Value array = apop();
|
|
Value length = NULL;
|
|
if (CSEArrayLength ||
|
|
(array->as_AccessField() && array->as_AccessField()->field()->is_constant()) ||
|
|
(array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) {
|
|
length = append(new ArrayLength(array, lock_stack()));
|
|
}
|
|
StoreIndexed* result = new StoreIndexed(array, index, length, type, value, lock_stack());
|
|
append(result);
|
|
_memory->store_value(value);
|
|
}
|
|
|
|
|
|
void GraphBuilder::stack_op(Bytecodes::Code code) {
|
|
switch (code) {
|
|
case Bytecodes::_pop:
|
|
{ state()->raw_pop();
|
|
}
|
|
break;
|
|
case Bytecodes::_pop2:
|
|
{ state()->raw_pop();
|
|
state()->raw_pop();
|
|
}
|
|
break;
|
|
case Bytecodes::_dup:
|
|
{ Value w = state()->raw_pop();
|
|
state()->raw_push(w);
|
|
state()->raw_push(w);
|
|
}
|
|
break;
|
|
case Bytecodes::_dup_x1:
|
|
{ Value w1 = state()->raw_pop();
|
|
Value w2 = state()->raw_pop();
|
|
state()->raw_push(w1);
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
}
|
|
break;
|
|
case Bytecodes::_dup_x2:
|
|
{ Value w1 = state()->raw_pop();
|
|
Value w2 = state()->raw_pop();
|
|
Value w3 = state()->raw_pop();
|
|
state()->raw_push(w1);
|
|
state()->raw_push(w3);
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
}
|
|
break;
|
|
case Bytecodes::_dup2:
|
|
{ Value w1 = state()->raw_pop();
|
|
Value w2 = state()->raw_pop();
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
}
|
|
break;
|
|
case Bytecodes::_dup2_x1:
|
|
{ Value w1 = state()->raw_pop();
|
|
Value w2 = state()->raw_pop();
|
|
Value w3 = state()->raw_pop();
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
state()->raw_push(w3);
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
}
|
|
break;
|
|
case Bytecodes::_dup2_x2:
|
|
{ Value w1 = state()->raw_pop();
|
|
Value w2 = state()->raw_pop();
|
|
Value w3 = state()->raw_pop();
|
|
Value w4 = state()->raw_pop();
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
state()->raw_push(w4);
|
|
state()->raw_push(w3);
|
|
state()->raw_push(w2);
|
|
state()->raw_push(w1);
|
|
}
|
|
break;
|
|
case Bytecodes::_swap:
|
|
{ Value w1 = state()->raw_pop();
|
|
Value w2 = state()->raw_pop();
|
|
state()->raw_push(w1);
|
|
state()->raw_push(w2);
|
|
}
|
|
break;
|
|
default:
|
|
ShouldNotReachHere();
|
|
break;
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* stack) {
|
|
Value y = pop(type);
|
|
Value x = pop(type);
|
|
// NOTE: strictfp can be queried from current method since we don't
|
|
// inline methods with differing strictfp bits
|
|
Value res = new ArithmeticOp(code, x, y, method()->is_strict(), stack);
|
|
// Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level
|
|
res = append(res);
|
|
if (method()->is_strict()) {
|
|
res = round_fp(res);
|
|
}
|
|
push(type, res);
|
|
}
|
|
|
|
|
|
void GraphBuilder::negate_op(ValueType* type) {
|
|
push(type, append(new NegateOp(pop(type))));
|
|
}
|
|
|
|
|
|
void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) {
|
|
Value s = ipop();
|
|
Value x = pop(type);
|
|
// try to simplify
|
|
// Note: This code should go into the canonicalizer as soon as it can
|
|
// can handle canonicalized forms that contain more than one node.
|
|
if (CanonicalizeNodes && code == Bytecodes::_iushr) {
|
|
// pattern: x >>> s
|
|
IntConstant* s1 = s->type()->as_IntConstant();
|
|
if (s1 != NULL) {
|
|
// pattern: x >>> s1, with s1 constant
|
|
ShiftOp* l = x->as_ShiftOp();
|
|
if (l != NULL && l->op() == Bytecodes::_ishl) {
|
|
// pattern: (a << b) >>> s1
|
|
IntConstant* s0 = l->y()->type()->as_IntConstant();
|
|
if (s0 != NULL) {
|
|
// pattern: (a << s0) >>> s1
|
|
const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts
|
|
const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts
|
|
if (s0c == s1c) {
|
|
if (s0c == 0) {
|
|
// pattern: (a << 0) >>> 0 => simplify to: a
|
|
ipush(l->x());
|
|
} else {
|
|
// pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant
|
|
assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases");
|
|
const int m = (1 << (BitsPerInt - s0c)) - 1;
|
|
Value s = append(new Constant(new IntConstant(m)));
|
|
ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s)));
|
|
}
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
// could not simplify
|
|
push(type, append(new ShiftOp(code, x, s)));
|
|
}
|
|
|
|
|
|
void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) {
|
|
Value y = pop(type);
|
|
Value x = pop(type);
|
|
push(type, append(new LogicOp(code, x, y)));
|
|
}
|
|
|
|
|
|
void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) {
|
|
ValueStack* state_before = state()->copy();
|
|
Value y = pop(type);
|
|
Value x = pop(type);
|
|
ipush(append(new CompareOp(code, x, y, state_before)));
|
|
}
|
|
|
|
|
|
void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) {
|
|
push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to))));
|
|
}
|
|
|
|
|
|
void GraphBuilder::increment() {
|
|
int index = stream()->get_index();
|
|
int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]);
|
|
load_local(intType, index);
|
|
ipush(append(new Constant(new IntConstant(delta))));
|
|
arithmetic_op(intType, Bytecodes::_iadd);
|
|
store_local(intType, index);
|
|
}
|
|
|
|
|
|
void GraphBuilder::_goto(int from_bci, int to_bci) {
|
|
profile_bci(from_bci);
|
|
append(new Goto(block_at(to_bci), to_bci <= from_bci));
|
|
}
|
|
|
|
|
|
void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) {
|
|
BlockBegin* tsux = block_at(stream()->get_dest());
|
|
BlockBegin* fsux = block_at(stream()->next_bci());
|
|
bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci();
|
|
If* if_node = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb))->as_If();
|
|
if (profile_branches() && (if_node != NULL)) {
|
|
if_node->set_profiled_method(method());
|
|
if_node->set_profiled_bci(bci());
|
|
if_node->set_should_profile(true);
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::if_zero(ValueType* type, If::Condition cond) {
|
|
Value y = append(new Constant(intZero));
|
|
ValueStack* state_before = state()->copy();
|
|
Value x = ipop();
|
|
if_node(x, cond, y, state_before);
|
|
}
|
|
|
|
|
|
void GraphBuilder::if_null(ValueType* type, If::Condition cond) {
|
|
Value y = append(new Constant(objectNull));
|
|
ValueStack* state_before = state()->copy();
|
|
Value x = apop();
|
|
if_node(x, cond, y, state_before);
|
|
}
|
|
|
|
|
|
void GraphBuilder::if_same(ValueType* type, If::Condition cond) {
|
|
ValueStack* state_before = state()->copy();
|
|
Value y = pop(type);
|
|
Value x = pop(type);
|
|
if_node(x, cond, y, state_before);
|
|
}
|
|
|
|
|
|
void GraphBuilder::jsr(int dest) {
|
|
// We only handle well-formed jsrs (those which are "block-structured").
|
|
// If the bytecodes are strange (jumping out of a jsr block) then we
|
|
// might end up trying to re-parse a block containing a jsr which
|
|
// has already been activated. Watch for this case and bail out.
|
|
for (ScopeData* cur_scope_data = scope_data();
|
|
cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope();
|
|
cur_scope_data = cur_scope_data->parent()) {
|
|
if (cur_scope_data->jsr_entry_bci() == dest) {
|
|
BAILOUT("too-complicated jsr/ret structure");
|
|
}
|
|
}
|
|
|
|
push(addressType, append(new Constant(new AddressConstant(next_bci()))));
|
|
if (!try_inline_jsr(dest)) {
|
|
return; // bailed out while parsing and inlining subroutine
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::ret(int local_index) {
|
|
if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine");
|
|
|
|
if (local_index != scope_data()->jsr_return_address_local()) {
|
|
BAILOUT("can not handle complicated jsr/ret constructs");
|
|
}
|
|
|
|
// Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation
|
|
append(new Goto(scope_data()->jsr_continuation(), false));
|
|
}
|
|
|
|
|
|
void GraphBuilder::table_switch() {
|
|
Bytecode_tableswitch* switch_ = Bytecode_tableswitch_at(method()->code() + bci());
|
|
const int l = switch_->length();
|
|
if (CanonicalizeNodes && l == 1) {
|
|
// total of 2 successors => use If instead of switch
|
|
// Note: This code should go into the canonicalizer as soon as it can
|
|
// can handle canonicalized forms that contain more than one node.
|
|
Value key = append(new Constant(new IntConstant(switch_->low_key())));
|
|
BlockBegin* tsux = block_at(bci() + switch_->dest_offset_at(0));
|
|
BlockBegin* fsux = block_at(bci() + switch_->default_offset());
|
|
bool is_bb = tsux->bci() < bci() || fsux->bci() < bci();
|
|
ValueStack* state_before = is_bb ? state() : NULL;
|
|
append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb));
|
|
} else {
|
|
// collect successors
|
|
BlockList* sux = new BlockList(l + 1, NULL);
|
|
int i;
|
|
bool has_bb = false;
|
|
for (i = 0; i < l; i++) {
|
|
sux->at_put(i, block_at(bci() + switch_->dest_offset_at(i)));
|
|
if (switch_->dest_offset_at(i) < 0) has_bb = true;
|
|
}
|
|
// add default successor
|
|
sux->at_put(i, block_at(bci() + switch_->default_offset()));
|
|
ValueStack* state_before = has_bb ? state() : NULL;
|
|
append(new TableSwitch(ipop(), sux, switch_->low_key(), state_before, has_bb));
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::lookup_switch() {
|
|
Bytecode_lookupswitch* switch_ = Bytecode_lookupswitch_at(method()->code() + bci());
|
|
const int l = switch_->number_of_pairs();
|
|
if (CanonicalizeNodes && l == 1) {
|
|
// total of 2 successors => use If instead of switch
|
|
// Note: This code should go into the canonicalizer as soon as it can
|
|
// can handle canonicalized forms that contain more than one node.
|
|
// simplify to If
|
|
LookupswitchPair* pair = switch_->pair_at(0);
|
|
Value key = append(new Constant(new IntConstant(pair->match())));
|
|
BlockBegin* tsux = block_at(bci() + pair->offset());
|
|
BlockBegin* fsux = block_at(bci() + switch_->default_offset());
|
|
bool is_bb = tsux->bci() < bci() || fsux->bci() < bci();
|
|
ValueStack* state_before = is_bb ? state() : NULL;
|
|
append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb));
|
|
} else {
|
|
// collect successors & keys
|
|
BlockList* sux = new BlockList(l + 1, NULL);
|
|
intArray* keys = new intArray(l, 0);
|
|
int i;
|
|
bool has_bb = false;
|
|
for (i = 0; i < l; i++) {
|
|
LookupswitchPair* pair = switch_->pair_at(i);
|
|
if (pair->offset() < 0) has_bb = true;
|
|
sux->at_put(i, block_at(bci() + pair->offset()));
|
|
keys->at_put(i, pair->match());
|
|
}
|
|
// add default successor
|
|
sux->at_put(i, block_at(bci() + switch_->default_offset()));
|
|
ValueStack* state_before = has_bb ? state() : NULL;
|
|
append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb));
|
|
}
|
|
}
|
|
|
|
void GraphBuilder::call_register_finalizer() {
|
|
// If the receiver requires finalization then emit code to perform
|
|
// the registration on return.
|
|
|
|
// Gather some type information about the receiver
|
|
Value receiver = state()->load_local(0);
|
|
assert(receiver != NULL, "must have a receiver");
|
|
ciType* declared_type = receiver->declared_type();
|
|
ciType* exact_type = receiver->exact_type();
|
|
if (exact_type == NULL &&
|
|
receiver->as_Local() &&
|
|
receiver->as_Local()->java_index() == 0) {
|
|
ciInstanceKlass* ik = compilation()->method()->holder();
|
|
if (ik->is_final()) {
|
|
exact_type = ik;
|
|
} else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) {
|
|
// test class is leaf class
|
|
compilation()->dependency_recorder()->assert_leaf_type(ik);
|
|
exact_type = ik;
|
|
} else {
|
|
declared_type = ik;
|
|
}
|
|
}
|
|
|
|
// see if we know statically that registration isn't required
|
|
bool needs_check = true;
|
|
if (exact_type != NULL) {
|
|
needs_check = exact_type->as_instance_klass()->has_finalizer();
|
|
} else if (declared_type != NULL) {
|
|
ciInstanceKlass* ik = declared_type->as_instance_klass();
|
|
if (!Dependencies::has_finalizable_subclass(ik)) {
|
|
compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik);
|
|
needs_check = false;
|
|
}
|
|
}
|
|
|
|
if (needs_check) {
|
|
// Perform the registration of finalizable objects.
|
|
load_local(objectType, 0);
|
|
append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init,
|
|
state()->pop_arguments(1),
|
|
true, lock_stack(), true));
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::method_return(Value x) {
|
|
if (RegisterFinalizersAtInit &&
|
|
method()->intrinsic_id() == vmIntrinsics::_Object_init) {
|
|
call_register_finalizer();
|
|
}
|
|
|
|
// Check to see whether we are inlining. If so, Return
|
|
// instructions become Gotos to the continuation point.
|
|
if (continuation() != NULL) {
|
|
assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet");
|
|
|
|
// If the inlined method is synchronized, the monitor must be
|
|
// released before we jump to the continuation block.
|
|
if (method()->is_synchronized()) {
|
|
int i = state()->caller_state()->locks_size();
|
|
assert(state()->locks_size() == i + 1, "receiver must be locked here");
|
|
monitorexit(state()->lock_at(i), SynchronizationEntryBCI);
|
|
}
|
|
|
|
state()->truncate_stack(caller_stack_size());
|
|
if (x != NULL) {
|
|
state()->push(x->type(), x);
|
|
}
|
|
Goto* goto_callee = new Goto(continuation(), false);
|
|
|
|
// See whether this is the first return; if so, store off some
|
|
// of the state for later examination
|
|
if (num_returns() == 0) {
|
|
set_inline_cleanup_info(_block, _last, state());
|
|
}
|
|
|
|
// State at end of inlined method is the state of the caller
|
|
// without the method parameters on stack, including the
|
|
// return value, if any, of the inlined method on operand stack.
|
|
set_state(scope_data()->continuation_state()->copy());
|
|
if (x) {
|
|
state()->push(x->type(), x);
|
|
}
|
|
|
|
// The current bci() is in the wrong scope, so use the bci() of
|
|
// the continuation point.
|
|
append_with_bci(goto_callee, scope_data()->continuation()->bci());
|
|
incr_num_returns();
|
|
|
|
return;
|
|
}
|
|
|
|
state()->truncate_stack(0);
|
|
if (method()->is_synchronized()) {
|
|
// perform the unlocking before exiting the method
|
|
Value receiver;
|
|
if (!method()->is_static()) {
|
|
receiver = _initial_state->local_at(0);
|
|
} else {
|
|
receiver = append(new Constant(new ClassConstant(method()->holder())));
|
|
}
|
|
append_split(new MonitorExit(receiver, state()->unlock()));
|
|
}
|
|
|
|
append(new Return(x));
|
|
}
|
|
|
|
|
|
void GraphBuilder::access_field(Bytecodes::Code code) {
|
|
bool will_link;
|
|
ciField* field = stream()->get_field(will_link);
|
|
ciInstanceKlass* holder = field->holder();
|
|
BasicType field_type = field->type()->basic_type();
|
|
ValueType* type = as_ValueType(field_type);
|
|
// call will_link again to determine if the field is valid.
|
|
const bool is_loaded = holder->is_loaded() &&
|
|
field->will_link(method()->holder(), code);
|
|
const bool is_initialized = is_loaded && holder->is_initialized();
|
|
|
|
ValueStack* state_copy = NULL;
|
|
if (!is_initialized || PatchALot) {
|
|
// save state before instruction for debug info when
|
|
// deoptimization happens during patching
|
|
state_copy = state()->copy();
|
|
}
|
|
|
|
Value obj = NULL;
|
|
if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) {
|
|
// commoning of class constants should only occur if the class is
|
|
// fully initialized and resolved in this constant pool. The will_link test
|
|
// above essentially checks if this class is resolved in this constant pool
|
|
// so, the is_initialized flag should be suffiect.
|
|
if (state_copy != NULL) {
|
|
// build a patching constant
|
|
obj = new Constant(new ClassConstant(holder), state_copy);
|
|
} else {
|
|
obj = new Constant(new ClassConstant(holder));
|
|
}
|
|
}
|
|
|
|
|
|
const int offset = is_loaded ? field->offset() : -1;
|
|
switch (code) {
|
|
case Bytecodes::_getstatic: {
|
|
// check for compile-time constants, i.e., initialized static final fields
|
|
Instruction* constant = NULL;
|
|
if (field->is_constant() && !PatchALot) {
|
|
ciConstant field_val = field->constant_value();
|
|
BasicType field_type = field_val.basic_type();
|
|
switch (field_type) {
|
|
case T_ARRAY:
|
|
case T_OBJECT:
|
|
if (field_val.as_object()->should_be_constant()) {
|
|
constant = new Constant(as_ValueType(field_val));
|
|
}
|
|
break;
|
|
|
|
default:
|
|
constant = new Constant(as_ValueType(field_val));
|
|
}
|
|
}
|
|
if (constant != NULL) {
|
|
push(type, append(constant));
|
|
state_copy = NULL; // Not a potential deoptimization point (see set_state_before logic below)
|
|
} else {
|
|
push(type, append(new LoadField(append(obj), offset, field, true,
|
|
lock_stack(), state_copy, is_loaded, is_initialized)));
|
|
}
|
|
break;
|
|
}
|
|
case Bytecodes::_putstatic:
|
|
{ Value val = pop(type);
|
|
append(new StoreField(append(obj), offset, field, val, true, lock_stack(), state_copy, is_loaded, is_initialized));
|
|
}
|
|
break;
|
|
case Bytecodes::_getfield :
|
|
{
|
|
LoadField* load = new LoadField(apop(), offset, field, false, lock_stack(), state_copy, is_loaded, true);
|
|
Value replacement = is_loaded ? _memory->load(load) : load;
|
|
if (replacement != load) {
|
|
assert(replacement->bci() != -99 || replacement->as_Phi() || replacement->as_Local(),
|
|
"should already by linked");
|
|
push(type, replacement);
|
|
} else {
|
|
push(type, append(load));
|
|
}
|
|
break;
|
|
}
|
|
|
|
case Bytecodes::_putfield :
|
|
{ Value val = pop(type);
|
|
StoreField* store = new StoreField(apop(), offset, field, val, false, lock_stack(), state_copy, is_loaded, true);
|
|
if (is_loaded) store = _memory->store(store);
|
|
if (store != NULL) {
|
|
append(store);
|
|
}
|
|
}
|
|
break;
|
|
default :
|
|
ShouldNotReachHere();
|
|
break;
|
|
}
|
|
}
|
|
|
|
|
|
Dependencies* GraphBuilder::dependency_recorder() const {
|
|
assert(DeoptC1, "need debug information");
|
|
return compilation()->dependency_recorder();
|
|
}
|
|
|
|
|
|
void GraphBuilder::invoke(Bytecodes::Code code) {
|
|
bool will_link;
|
|
ciMethod* target = stream()->get_method(will_link);
|
|
// we have to make sure the argument size (incl. the receiver)
|
|
// is correct for compilation (the call would fail later during
|
|
// linkage anyway) - was bug (gri 7/28/99)
|
|
if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error");
|
|
ciInstanceKlass* klass = target->holder();
|
|
|
|
// check if CHA possible: if so, change the code to invoke_special
|
|
ciInstanceKlass* calling_klass = method()->holder();
|
|
ciKlass* holder = stream()->get_declared_method_holder();
|
|
ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder);
|
|
ciInstanceKlass* actual_recv = callee_holder;
|
|
|
|
// some methods are obviously bindable without any type checks so
|
|
// convert them directly to an invokespecial.
|
|
if (target->is_loaded() && !target->is_abstract() &&
|
|
target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) {
|
|
code = Bytecodes::_invokespecial;
|
|
}
|
|
|
|
// NEEDS_CLEANUP
|
|
// I've added the target-is_loaded() test below but I don't really understand
|
|
// how klass->is_loaded() can be true and yet target->is_loaded() is false.
|
|
// this happened while running the JCK invokevirtual tests under doit. TKR
|
|
ciMethod* cha_monomorphic_target = NULL;
|
|
ciMethod* exact_target = NULL;
|
|
if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded() &&
|
|
!target->is_method_handle_invoke()) {
|
|
Value receiver = NULL;
|
|
ciInstanceKlass* receiver_klass = NULL;
|
|
bool type_is_exact = false;
|
|
// try to find a precise receiver type
|
|
if (will_link && !target->is_static()) {
|
|
int index = state()->stack_size() - (target->arg_size_no_receiver() + 1);
|
|
receiver = state()->stack_at(index);
|
|
ciType* type = receiver->exact_type();
|
|
if (type != NULL && type->is_loaded() &&
|
|
type->is_instance_klass() && !type->as_instance_klass()->is_interface()) {
|
|
receiver_klass = (ciInstanceKlass*) type;
|
|
type_is_exact = true;
|
|
}
|
|
if (type == NULL) {
|
|
type = receiver->declared_type();
|
|
if (type != NULL && type->is_loaded() &&
|
|
type->is_instance_klass() && !type->as_instance_klass()->is_interface()) {
|
|
receiver_klass = (ciInstanceKlass*) type;
|
|
if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) {
|
|
// Insert a dependency on this type since
|
|
// find_monomorphic_target may assume it's already done.
|
|
dependency_recorder()->assert_leaf_type(receiver_klass);
|
|
type_is_exact = true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if (receiver_klass != NULL && type_is_exact &&
|
|
receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) {
|
|
// If we have the exact receiver type we can bind directly to
|
|
// the method to call.
|
|
exact_target = target->resolve_invoke(calling_klass, receiver_klass);
|
|
if (exact_target != NULL) {
|
|
target = exact_target;
|
|
code = Bytecodes::_invokespecial;
|
|
}
|
|
}
|
|
if (receiver_klass != NULL &&
|
|
receiver_klass->is_subtype_of(actual_recv) &&
|
|
actual_recv->is_initialized()) {
|
|
actual_recv = receiver_klass;
|
|
}
|
|
|
|
if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) ||
|
|
(code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) {
|
|
// Use CHA on the receiver to select a more precise method.
|
|
cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv);
|
|
} else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) {
|
|
// if there is only one implementor of this interface then we
|
|
// may be able bind this invoke directly to the implementing
|
|
// klass but we need both a dependence on the single interface
|
|
// and on the method we bind to. Additionally since all we know
|
|
// about the receiver type is the it's supposed to implement the
|
|
// interface we have to insert a check that it's the class we
|
|
// expect. Interface types are not checked by the verifier so
|
|
// they are roughly equivalent to Object.
|
|
ciInstanceKlass* singleton = NULL;
|
|
if (target->holder()->nof_implementors() == 1) {
|
|
singleton = target->holder()->implementor(0);
|
|
}
|
|
if (singleton) {
|
|
cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton);
|
|
if (cha_monomorphic_target != NULL) {
|
|
// If CHA is able to bind this invoke then update the class
|
|
// to match that class, otherwise klass will refer to the
|
|
// interface.
|
|
klass = cha_monomorphic_target->holder();
|
|
actual_recv = target->holder();
|
|
|
|
// insert a check it's really the expected class.
|
|
CheckCast* c = new CheckCast(klass, receiver, NULL);
|
|
c->set_incompatible_class_change_check();
|
|
c->set_direct_compare(klass->is_final());
|
|
append_split(c);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
if (cha_monomorphic_target != NULL) {
|
|
if (cha_monomorphic_target->is_abstract()) {
|
|
// Do not optimize for abstract methods
|
|
cha_monomorphic_target = NULL;
|
|
}
|
|
}
|
|
|
|
if (cha_monomorphic_target != NULL) {
|
|
if (!(target->is_final_method())) {
|
|
// If we inlined because CHA revealed only a single target method,
|
|
// then we are dependent on that target method not getting overridden
|
|
// by dynamic class loading. Be sure to test the "static" receiver
|
|
// dest_method here, as opposed to the actual receiver, which may
|
|
// falsely lead us to believe that the receiver is final or private.
|
|
dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target);
|
|
}
|
|
code = Bytecodes::_invokespecial;
|
|
}
|
|
// check if we could do inlining
|
|
if (!PatchALot && Inline && klass->is_loaded() &&
|
|
(klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized())
|
|
&& target->will_link(klass, callee_holder, code)) {
|
|
// callee is known => check if we have static binding
|
|
assert(target->is_loaded(), "callee must be known");
|
|
if (code == Bytecodes::_invokestatic
|
|
|| code == Bytecodes::_invokespecial
|
|
|| code == Bytecodes::_invokevirtual && target->is_final_method()
|
|
) {
|
|
// static binding => check if callee is ok
|
|
ciMethod* inline_target = (cha_monomorphic_target != NULL)
|
|
? cha_monomorphic_target
|
|
: target;
|
|
bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL));
|
|
CHECK_BAILOUT();
|
|
|
|
#ifndef PRODUCT
|
|
// printing
|
|
if (PrintInlining && !res) {
|
|
// if it was successfully inlined, then it was already printed.
|
|
print_inline_result(inline_target, res);
|
|
}
|
|
#endif
|
|
clear_inline_bailout();
|
|
if (res) {
|
|
// Register dependence if JVMTI has either breakpoint
|
|
// setting or hotswapping of methods capabilities since they may
|
|
// cause deoptimization.
|
|
if (compilation()->env()->jvmti_can_hotswap_or_post_breakpoint()) {
|
|
dependency_recorder()->assert_evol_method(inline_target);
|
|
}
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
// If we attempted an inline which did not succeed because of a
|
|
// bailout during construction of the callee graph, the entire
|
|
// compilation has to be aborted. This is fairly rare and currently
|
|
// seems to only occur for jasm-generated classes which contain
|
|
// jsr/ret pairs which are not associated with finally clauses and
|
|
// do not have exception handlers in the containing method, and are
|
|
// therefore not caught early enough to abort the inlining without
|
|
// corrupting the graph. (We currently bail out with a non-empty
|
|
// stack at a ret in these situations.)
|
|
CHECK_BAILOUT();
|
|
|
|
// inlining not successful => standard invoke
|
|
bool is_loaded = target->is_loaded();
|
|
bool has_receiver =
|
|
code == Bytecodes::_invokespecial ||
|
|
code == Bytecodes::_invokevirtual ||
|
|
code == Bytecodes::_invokeinterface;
|
|
bool is_invokedynamic = code == Bytecodes::_invokedynamic;
|
|
ValueType* result_type = as_ValueType(target->return_type());
|
|
|
|
// We require the debug info to be the "state before" because
|
|
// invokedynamics may deoptimize.
|
|
ValueStack* state_before = is_invokedynamic ? state()->copy() : NULL;
|
|
|
|
Values* args = state()->pop_arguments(target->arg_size_no_receiver());
|
|
Value recv = has_receiver ? apop() : NULL;
|
|
int vtable_index = methodOopDesc::invalid_vtable_index;
|
|
|
|
#ifdef SPARC
|
|
// Currently only supported on Sparc.
|
|
// The UseInlineCaches only controls dispatch to invokevirtuals for
|
|
// loaded classes which we weren't able to statically bind.
|
|
if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual
|
|
&& !target->can_be_statically_bound()) {
|
|
// Find a vtable index if one is available
|
|
vtable_index = target->resolve_vtable_index(calling_klass, callee_holder);
|
|
}
|
|
#endif
|
|
|
|
if (recv != NULL &&
|
|
(code == Bytecodes::_invokespecial ||
|
|
!is_loaded || target->is_final() ||
|
|
profile_calls())) {
|
|
// invokespecial always needs a NULL check. invokevirtual where
|
|
// the target is final or where it's not known that whether the
|
|
// target is final requires a NULL check. Otherwise normal
|
|
// invokevirtual will perform the null check during the lookup
|
|
// logic or the unverified entry point. Profiling of calls
|
|
// requires that the null check is performed in all cases.
|
|
null_check(recv);
|
|
}
|
|
|
|
if (profile_calls()) {
|
|
assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set");
|
|
ciKlass* target_klass = NULL;
|
|
if (cha_monomorphic_target != NULL) {
|
|
target_klass = cha_monomorphic_target->holder();
|
|
} else if (exact_target != NULL) {
|
|
target_klass = exact_target->holder();
|
|
}
|
|
profile_call(recv, target_klass);
|
|
}
|
|
|
|
Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target, state_before);
|
|
// push result
|
|
append_split(result);
|
|
|
|
if (result_type != voidType) {
|
|
if (method()->is_strict()) {
|
|
push(result_type, round_fp(result));
|
|
} else {
|
|
push(result_type, result);
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::new_instance(int klass_index) {
|
|
bool will_link;
|
|
ciKlass* klass = stream()->get_klass(will_link);
|
|
assert(klass->is_instance_klass(), "must be an instance klass");
|
|
NewInstance* new_instance = new NewInstance(klass->as_instance_klass());
|
|
_memory->new_instance(new_instance);
|
|
apush(append_split(new_instance));
|
|
}
|
|
|
|
|
|
void GraphBuilder::new_type_array() {
|
|
apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index())));
|
|
}
|
|
|
|
|
|
void GraphBuilder::new_object_array() {
|
|
bool will_link;
|
|
ciKlass* klass = stream()->get_klass(will_link);
|
|
ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
NewArray* n = new NewObjectArray(klass, ipop(), state_before);
|
|
apush(append_split(n));
|
|
}
|
|
|
|
|
|
bool GraphBuilder::direct_compare(ciKlass* k) {
|
|
if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) {
|
|
ciInstanceKlass* ik = k->as_instance_klass();
|
|
if (ik->is_final()) {
|
|
return true;
|
|
} else {
|
|
if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) {
|
|
// test class is leaf class
|
|
dependency_recorder()->assert_leaf_type(ik);
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
|
|
void GraphBuilder::check_cast(int klass_index) {
|
|
bool will_link;
|
|
ciKlass* klass = stream()->get_klass(will_link);
|
|
ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
CheckCast* c = new CheckCast(klass, apop(), state_before);
|
|
apush(append_split(c));
|
|
c->set_direct_compare(direct_compare(klass));
|
|
if (profile_checkcasts()) {
|
|
c->set_profiled_method(method());
|
|
c->set_profiled_bci(bci());
|
|
c->set_should_profile(true);
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::instance_of(int klass_index) {
|
|
bool will_link;
|
|
ciKlass* klass = stream()->get_klass(will_link);
|
|
ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
InstanceOf* i = new InstanceOf(klass, apop(), state_before);
|
|
ipush(append_split(i));
|
|
i->set_direct_compare(direct_compare(klass));
|
|
}
|
|
|
|
|
|
void GraphBuilder::monitorenter(Value x, int bci) {
|
|
// save state before locking in case of deoptimization after a NullPointerException
|
|
ValueStack* lock_stack_before = lock_stack();
|
|
append_with_bci(new MonitorEnter(x, state()->lock(scope(), x), lock_stack_before), bci);
|
|
kill_all();
|
|
}
|
|
|
|
|
|
void GraphBuilder::monitorexit(Value x, int bci) {
|
|
// Note: the comment below is only relevant for the case where we do
|
|
// not deoptimize due to asynchronous exceptions (!(DeoptC1 &&
|
|
// DeoptOnAsyncException), which is not used anymore)
|
|
|
|
// Note: Potentially, the monitor state in an exception handler
|
|
// can be wrong due to wrong 'initialization' of the handler
|
|
// via a wrong asynchronous exception path. This can happen,
|
|
// if the exception handler range for asynchronous exceptions
|
|
// is too long (see also java bug 4327029, and comment in
|
|
// GraphBuilder::handle_exception()). This may cause 'under-
|
|
// flow' of the monitor stack => bailout instead.
|
|
if (state()->locks_size() < 1) BAILOUT("monitor stack underflow");
|
|
append_with_bci(new MonitorExit(x, state()->unlock()), bci);
|
|
kill_all();
|
|
}
|
|
|
|
|
|
void GraphBuilder::new_multi_array(int dimensions) {
|
|
bool will_link;
|
|
ciKlass* klass = stream()->get_klass(will_link);
|
|
ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
|
|
Values* dims = new Values(dimensions, NULL);
|
|
// fill in all dimensions
|
|
int i = dimensions;
|
|
while (i-- > 0) dims->at_put(i, ipop());
|
|
// create array
|
|
NewArray* n = new NewMultiArray(klass, dims, state_before);
|
|
apush(append_split(n));
|
|
}
|
|
|
|
|
|
void GraphBuilder::throw_op(int bci) {
|
|
// We require that the debug info for a Throw be the "state before"
|
|
// the Throw (i.e., exception oop is still on TOS)
|
|
ValueStack* state_before = state()->copy();
|
|
Throw* t = new Throw(apop(), state_before);
|
|
append_with_bci(t, bci);
|
|
}
|
|
|
|
|
|
Value GraphBuilder::round_fp(Value fp_value) {
|
|
// no rounding needed if SSE2 is used
|
|
if (RoundFPResults && UseSSE < 2) {
|
|
// Must currently insert rounding node for doubleword values that
|
|
// are results of expressions (i.e., not loads from memory or
|
|
// constants)
|
|
if (fp_value->type()->tag() == doubleTag &&
|
|
fp_value->as_Constant() == NULL &&
|
|
fp_value->as_Local() == NULL && // method parameters need no rounding
|
|
fp_value->as_RoundFP() == NULL) {
|
|
return append(new RoundFP(fp_value));
|
|
}
|
|
}
|
|
return fp_value;
|
|
}
|
|
|
|
|
|
Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) {
|
|
Canonicalizer canon(instr, bci);
|
|
Instruction* i1 = canon.canonical();
|
|
if (i1->bci() != -99) {
|
|
// Canonicalizer returned an instruction which was already
|
|
// appended so simply return it.
|
|
return i1;
|
|
} else if (UseLocalValueNumbering) {
|
|
// Lookup the instruction in the ValueMap and add it to the map if
|
|
// it's not found.
|
|
Instruction* i2 = vmap()->find_insert(i1);
|
|
if (i2 != i1) {
|
|
// found an entry in the value map, so just return it.
|
|
assert(i2->bci() != -1, "should already be linked");
|
|
return i2;
|
|
}
|
|
ValueNumberingEffects vne(vmap());
|
|
i1->visit(&vne);
|
|
}
|
|
|
|
if (i1->as_Phi() == NULL && i1->as_Local() == NULL) {
|
|
// i1 was not eliminated => append it
|
|
assert(i1->next() == NULL, "shouldn't already be linked");
|
|
_last = _last->set_next(i1, canon.bci());
|
|
if (++_instruction_count >= InstructionCountCutoff
|
|
&& !bailed_out()) {
|
|
// set the bailout state but complete normal processing. We
|
|
// might do a little more work before noticing the bailout so we
|
|
// want processing to continue normally until it's noticed.
|
|
bailout("Method and/or inlining is too large");
|
|
}
|
|
|
|
#ifndef PRODUCT
|
|
if (PrintIRDuringConstruction) {
|
|
InstructionPrinter ip;
|
|
ip.print_line(i1);
|
|
if (Verbose) {
|
|
state()->print();
|
|
}
|
|
}
|
|
#endif
|
|
assert(_last == i1, "adjust code below");
|
|
StateSplit* s = i1->as_StateSplit();
|
|
if (s != NULL && i1->as_BlockEnd() == NULL) {
|
|
if (EliminateFieldAccess) {
|
|
Intrinsic* intrinsic = s->as_Intrinsic();
|
|
if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) {
|
|
_memory->kill();
|
|
}
|
|
}
|
|
s->set_state(state()->copy());
|
|
}
|
|
// set up exception handlers for this instruction if necessary
|
|
if (i1->can_trap()) {
|
|
assert(exception_state() != NULL || !has_handler(), "must have setup exception state");
|
|
i1->set_exception_handlers(handle_exception(bci));
|
|
}
|
|
}
|
|
return i1;
|
|
}
|
|
|
|
|
|
Instruction* GraphBuilder::append(Instruction* instr) {
|
|
assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used");
|
|
return append_with_bci(instr, bci());
|
|
}
|
|
|
|
|
|
Instruction* GraphBuilder::append_split(StateSplit* instr) {
|
|
return append_with_bci(instr, bci());
|
|
}
|
|
|
|
|
|
void GraphBuilder::null_check(Value value) {
|
|
if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) {
|
|
return;
|
|
} else {
|
|
Constant* con = value->as_Constant();
|
|
if (con) {
|
|
ObjectType* c = con->type()->as_ObjectType();
|
|
if (c && c->is_loaded()) {
|
|
ObjectConstant* oc = c->as_ObjectConstant();
|
|
if (!oc || !oc->value()->is_null_object()) {
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
append(new NullCheck(value, lock_stack()));
|
|
}
|
|
|
|
|
|
|
|
XHandlers* GraphBuilder::handle_exception(int cur_bci) {
|
|
// fast path if it is guaranteed that no exception handlers are present
|
|
if (!has_handler()) {
|
|
// TODO: check if return NULL is possible (avoids empty lists)
|
|
return new XHandlers();
|
|
}
|
|
|
|
XHandlers* exception_handlers = new XHandlers();
|
|
ScopeData* cur_scope_data = scope_data();
|
|
ValueStack* s = exception_state();
|
|
int scope_count = 0;
|
|
|
|
assert(s != NULL, "exception state must be set");
|
|
do {
|
|
assert(cur_scope_data->scope() == s->scope(), "scopes do not match");
|
|
assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci");
|
|
|
|
// join with all potential exception handlers
|
|
XHandlers* list = cur_scope_data->xhandlers();
|
|
const int n = list->length();
|
|
for (int i = 0; i < n; i++) {
|
|
XHandler* h = list->handler_at(i);
|
|
if (h->covers(cur_bci)) {
|
|
// h is a potential exception handler => join it
|
|
compilation()->set_has_exception_handlers(true);
|
|
|
|
BlockBegin* entry = h->entry_block();
|
|
if (entry == block()) {
|
|
// It's acceptable for an exception handler to cover itself
|
|
// but we don't handle that in the parser currently. It's
|
|
// very rare so we bailout instead of trying to handle it.
|
|
BAILOUT_("exception handler covers itself", exception_handlers);
|
|
}
|
|
assert(entry->bci() == h->handler_bci(), "must match");
|
|
assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond");
|
|
|
|
// previously this was a BAILOUT, but this is not necessary
|
|
// now because asynchronous exceptions are not handled this way.
|
|
assert(entry->state() == NULL || s->locks_size() == entry->state()->locks_size(), "locks do not match");
|
|
|
|
// xhandler start with an empty expression stack
|
|
s->truncate_stack(cur_scope_data->caller_stack_size());
|
|
|
|
// Note: Usually this join must work. However, very
|
|
// complicated jsr-ret structures where we don't ret from
|
|
// the subroutine can cause the objects on the monitor
|
|
// stacks to not match because blocks can be parsed twice.
|
|
// The only test case we've seen so far which exhibits this
|
|
// problem is caught by the infinite recursion test in
|
|
// GraphBuilder::jsr() if the join doesn't work.
|
|
if (!entry->try_merge(s)) {
|
|
BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers);
|
|
}
|
|
|
|
// add current state for correct handling of phi functions at begin of xhandler
|
|
int phi_operand = entry->add_exception_state(s);
|
|
|
|
// add entry to the list of xhandlers of this block
|
|
_block->add_exception_handler(entry);
|
|
|
|
// add back-edge from xhandler entry to this block
|
|
if (!entry->is_predecessor(_block)) {
|
|
entry->add_predecessor(_block);
|
|
}
|
|
|
|
// clone XHandler because phi_operand and scope_count can not be shared
|
|
XHandler* new_xhandler = new XHandler(h);
|
|
new_xhandler->set_phi_operand(phi_operand);
|
|
new_xhandler->set_scope_count(scope_count);
|
|
exception_handlers->append(new_xhandler);
|
|
|
|
// fill in exception handler subgraph lazily
|
|
assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet");
|
|
cur_scope_data->add_to_work_list(entry);
|
|
|
|
// stop when reaching catchall
|
|
if (h->catch_type() == 0) {
|
|
return exception_handlers;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Set up iteration for next time.
|
|
// If parsing a jsr, do not grab exception handlers from the
|
|
// parent scopes for this method (already got them, and they
|
|
// needed to be cloned)
|
|
if (cur_scope_data->parsing_jsr()) {
|
|
IRScope* tmp_scope = cur_scope_data->scope();
|
|
while (cur_scope_data->parent() != NULL &&
|
|
cur_scope_data->parent()->scope() == tmp_scope) {
|
|
cur_scope_data = cur_scope_data->parent();
|
|
}
|
|
}
|
|
if (cur_scope_data != NULL) {
|
|
if (cur_scope_data->parent() != NULL) {
|
|
// must use pop_scope instead of caller_state to preserve all monitors
|
|
s = s->pop_scope();
|
|
}
|
|
cur_bci = cur_scope_data->scope()->caller_bci();
|
|
cur_scope_data = cur_scope_data->parent();
|
|
scope_count++;
|
|
}
|
|
} while (cur_scope_data != NULL);
|
|
|
|
return exception_handlers;
|
|
}
|
|
|
|
|
|
// Helper class for simplifying Phis.
|
|
class PhiSimplifier : public BlockClosure {
|
|
private:
|
|
bool _has_substitutions;
|
|
Value simplify(Value v);
|
|
|
|
public:
|
|
PhiSimplifier(BlockBegin* start) : _has_substitutions(false) {
|
|
start->iterate_preorder(this);
|
|
if (_has_substitutions) {
|
|
SubstitutionResolver sr(start);
|
|
}
|
|
}
|
|
void block_do(BlockBegin* b);
|
|
bool has_substitutions() const { return _has_substitutions; }
|
|
};
|
|
|
|
|
|
Value PhiSimplifier::simplify(Value v) {
|
|
Phi* phi = v->as_Phi();
|
|
|
|
if (phi == NULL) {
|
|
// no phi function
|
|
return v;
|
|
} else if (v->has_subst()) {
|
|
// already substituted; subst can be phi itself -> simplify
|
|
return simplify(v->subst());
|
|
} else if (phi->is_set(Phi::cannot_simplify)) {
|
|
// already tried to simplify phi before
|
|
return phi;
|
|
} else if (phi->is_set(Phi::visited)) {
|
|
// break cycles in phi functions
|
|
return phi;
|
|
} else if (phi->type()->is_illegal()) {
|
|
// illegal phi functions are ignored anyway
|
|
return phi;
|
|
|
|
} else {
|
|
// mark phi function as processed to break cycles in phi functions
|
|
phi->set(Phi::visited);
|
|
|
|
// simplify x = [y, x] and x = [y, y] to y
|
|
Value subst = NULL;
|
|
int opd_count = phi->operand_count();
|
|
for (int i = 0; i < opd_count; i++) {
|
|
Value opd = phi->operand_at(i);
|
|
assert(opd != NULL, "Operand must exist!");
|
|
|
|
if (opd->type()->is_illegal()) {
|
|
// if one operand is illegal, the entire phi function is illegal
|
|
phi->make_illegal();
|
|
phi->clear(Phi::visited);
|
|
return phi;
|
|
}
|
|
|
|
Value new_opd = simplify(opd);
|
|
assert(new_opd != NULL, "Simplified operand must exist!");
|
|
|
|
if (new_opd != phi && new_opd != subst) {
|
|
if (subst == NULL) {
|
|
subst = new_opd;
|
|
} else {
|
|
// no simplification possible
|
|
phi->set(Phi::cannot_simplify);
|
|
phi->clear(Phi::visited);
|
|
return phi;
|
|
}
|
|
}
|
|
}
|
|
|
|
// sucessfully simplified phi function
|
|
assert(subst != NULL, "illegal phi function");
|
|
_has_substitutions = true;
|
|
phi->clear(Phi::visited);
|
|
phi->set_subst(subst);
|
|
|
|
#ifndef PRODUCT
|
|
if (PrintPhiFunctions) {
|
|
tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id());
|
|
}
|
|
#endif
|
|
|
|
return subst;
|
|
}
|
|
}
|
|
|
|
|
|
void PhiSimplifier::block_do(BlockBegin* b) {
|
|
for_each_phi_fun(b, phi,
|
|
simplify(phi);
|
|
);
|
|
|
|
#ifdef ASSERT
|
|
for_each_phi_fun(b, phi,
|
|
assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification");
|
|
);
|
|
|
|
ValueStack* state = b->state()->caller_state();
|
|
int index;
|
|
Value value;
|
|
for_each_state(state) {
|
|
for_each_local_value(state, index, value) {
|
|
Phi* phi = value->as_Phi();
|
|
assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state");
|
|
}
|
|
}
|
|
#endif
|
|
}
|
|
|
|
// This method is called after all blocks are filled with HIR instructions
|
|
// It eliminates all Phi functions of the form x = [y, y] and x = [y, x]
|
|
void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) {
|
|
PhiSimplifier simplifier(start);
|
|
}
|
|
|
|
|
|
void GraphBuilder::connect_to_end(BlockBegin* beg) {
|
|
// setup iteration
|
|
kill_all();
|
|
_block = beg;
|
|
_state = beg->state()->copy();
|
|
_last = beg;
|
|
iterate_bytecodes_for_block(beg->bci());
|
|
}
|
|
|
|
|
|
BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) {
|
|
#ifndef PRODUCT
|
|
if (PrintIRDuringConstruction) {
|
|
tty->cr();
|
|
InstructionPrinter ip;
|
|
ip.print_instr(_block); tty->cr();
|
|
ip.print_stack(_block->state()); tty->cr();
|
|
ip.print_inline_level(_block);
|
|
ip.print_head();
|
|
tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size());
|
|
}
|
|
#endif
|
|
_skip_block = false;
|
|
assert(state() != NULL, "ValueStack missing!");
|
|
ciBytecodeStream s(method());
|
|
s.reset_to_bci(bci);
|
|
int prev_bci = bci;
|
|
scope_data()->set_stream(&s);
|
|
// iterate
|
|
Bytecodes::Code code = Bytecodes::_illegal;
|
|
bool push_exception = false;
|
|
|
|
if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) {
|
|
// first thing in the exception entry block should be the exception object.
|
|
push_exception = true;
|
|
}
|
|
|
|
while (!bailed_out() && last()->as_BlockEnd() == NULL &&
|
|
(code = stream()->next()) != ciBytecodeStream::EOBC() &&
|
|
(block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) {
|
|
|
|
if (has_handler() && can_trap(method(), code)) {
|
|
// copy the state because it is modified before handle_exception is called
|
|
set_exception_state(state()->copy());
|
|
} else {
|
|
// handle_exception is not called for this bytecode
|
|
set_exception_state(NULL);
|
|
}
|
|
|
|
// Check for active jsr during OSR compilation
|
|
if (compilation()->is_osr_compile()
|
|
&& scope()->is_top_scope()
|
|
&& parsing_jsr()
|
|
&& s.cur_bci() == compilation()->osr_bci()) {
|
|
bailout("OSR not supported while a jsr is active");
|
|
}
|
|
|
|
if (push_exception) {
|
|
apush(append(new ExceptionObject()));
|
|
push_exception = false;
|
|
}
|
|
|
|
// handle bytecode
|
|
switch (code) {
|
|
case Bytecodes::_nop : /* nothing to do */ break;
|
|
case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break;
|
|
case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break;
|
|
case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break;
|
|
case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break;
|
|
case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break;
|
|
case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break;
|
|
case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break;
|
|
case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break;
|
|
case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break;
|
|
case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break;
|
|
case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break;
|
|
case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break;
|
|
case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break;
|
|
case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break;
|
|
case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break;
|
|
case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break;
|
|
case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break;
|
|
case Bytecodes::_ldc : // fall through
|
|
case Bytecodes::_ldc_w : // fall through
|
|
case Bytecodes::_ldc2_w : load_constant(); break;
|
|
case Bytecodes::_iload : load_local(intType , s.get_index()); break;
|
|
case Bytecodes::_lload : load_local(longType , s.get_index()); break;
|
|
case Bytecodes::_fload : load_local(floatType , s.get_index()); break;
|
|
case Bytecodes::_dload : load_local(doubleType , s.get_index()); break;
|
|
case Bytecodes::_aload : load_local(instanceType, s.get_index()); break;
|
|
case Bytecodes::_iload_0 : load_local(intType , 0); break;
|
|
case Bytecodes::_iload_1 : load_local(intType , 1); break;
|
|
case Bytecodes::_iload_2 : load_local(intType , 2); break;
|
|
case Bytecodes::_iload_3 : load_local(intType , 3); break;
|
|
case Bytecodes::_lload_0 : load_local(longType , 0); break;
|
|
case Bytecodes::_lload_1 : load_local(longType , 1); break;
|
|
case Bytecodes::_lload_2 : load_local(longType , 2); break;
|
|
case Bytecodes::_lload_3 : load_local(longType , 3); break;
|
|
case Bytecodes::_fload_0 : load_local(floatType , 0); break;
|
|
case Bytecodes::_fload_1 : load_local(floatType , 1); break;
|
|
case Bytecodes::_fload_2 : load_local(floatType , 2); break;
|
|
case Bytecodes::_fload_3 : load_local(floatType , 3); break;
|
|
case Bytecodes::_dload_0 : load_local(doubleType, 0); break;
|
|
case Bytecodes::_dload_1 : load_local(doubleType, 1); break;
|
|
case Bytecodes::_dload_2 : load_local(doubleType, 2); break;
|
|
case Bytecodes::_dload_3 : load_local(doubleType, 3); break;
|
|
case Bytecodes::_aload_0 : load_local(objectType, 0); break;
|
|
case Bytecodes::_aload_1 : load_local(objectType, 1); break;
|
|
case Bytecodes::_aload_2 : load_local(objectType, 2); break;
|
|
case Bytecodes::_aload_3 : load_local(objectType, 3); break;
|
|
case Bytecodes::_iaload : load_indexed(T_INT ); break;
|
|
case Bytecodes::_laload : load_indexed(T_LONG ); break;
|
|
case Bytecodes::_faload : load_indexed(T_FLOAT ); break;
|
|
case Bytecodes::_daload : load_indexed(T_DOUBLE); break;
|
|
case Bytecodes::_aaload : load_indexed(T_OBJECT); break;
|
|
case Bytecodes::_baload : load_indexed(T_BYTE ); break;
|
|
case Bytecodes::_caload : load_indexed(T_CHAR ); break;
|
|
case Bytecodes::_saload : load_indexed(T_SHORT ); break;
|
|
case Bytecodes::_istore : store_local(intType , s.get_index()); break;
|
|
case Bytecodes::_lstore : store_local(longType , s.get_index()); break;
|
|
case Bytecodes::_fstore : store_local(floatType , s.get_index()); break;
|
|
case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break;
|
|
case Bytecodes::_astore : store_local(objectType, s.get_index()); break;
|
|
case Bytecodes::_istore_0 : store_local(intType , 0); break;
|
|
case Bytecodes::_istore_1 : store_local(intType , 1); break;
|
|
case Bytecodes::_istore_2 : store_local(intType , 2); break;
|
|
case Bytecodes::_istore_3 : store_local(intType , 3); break;
|
|
case Bytecodes::_lstore_0 : store_local(longType , 0); break;
|
|
case Bytecodes::_lstore_1 : store_local(longType , 1); break;
|
|
case Bytecodes::_lstore_2 : store_local(longType , 2); break;
|
|
case Bytecodes::_lstore_3 : store_local(longType , 3); break;
|
|
case Bytecodes::_fstore_0 : store_local(floatType , 0); break;
|
|
case Bytecodes::_fstore_1 : store_local(floatType , 1); break;
|
|
case Bytecodes::_fstore_2 : store_local(floatType , 2); break;
|
|
case Bytecodes::_fstore_3 : store_local(floatType , 3); break;
|
|
case Bytecodes::_dstore_0 : store_local(doubleType, 0); break;
|
|
case Bytecodes::_dstore_1 : store_local(doubleType, 1); break;
|
|
case Bytecodes::_dstore_2 : store_local(doubleType, 2); break;
|
|
case Bytecodes::_dstore_3 : store_local(doubleType, 3); break;
|
|
case Bytecodes::_astore_0 : store_local(objectType, 0); break;
|
|
case Bytecodes::_astore_1 : store_local(objectType, 1); break;
|
|
case Bytecodes::_astore_2 : store_local(objectType, 2); break;
|
|
case Bytecodes::_astore_3 : store_local(objectType, 3); break;
|
|
case Bytecodes::_iastore : store_indexed(T_INT ); break;
|
|
case Bytecodes::_lastore : store_indexed(T_LONG ); break;
|
|
case Bytecodes::_fastore : store_indexed(T_FLOAT ); break;
|
|
case Bytecodes::_dastore : store_indexed(T_DOUBLE); break;
|
|
case Bytecodes::_aastore : store_indexed(T_OBJECT); break;
|
|
case Bytecodes::_bastore : store_indexed(T_BYTE ); break;
|
|
case Bytecodes::_castore : store_indexed(T_CHAR ); break;
|
|
case Bytecodes::_sastore : store_indexed(T_SHORT ); break;
|
|
case Bytecodes::_pop : // fall through
|
|
case Bytecodes::_pop2 : // fall through
|
|
case Bytecodes::_dup : // fall through
|
|
case Bytecodes::_dup_x1 : // fall through
|
|
case Bytecodes::_dup_x2 : // fall through
|
|
case Bytecodes::_dup2 : // fall through
|
|
case Bytecodes::_dup2_x1 : // fall through
|
|
case Bytecodes::_dup2_x2 : // fall through
|
|
case Bytecodes::_swap : stack_op(code); break;
|
|
case Bytecodes::_iadd : arithmetic_op(intType , code); break;
|
|
case Bytecodes::_ladd : arithmetic_op(longType , code); break;
|
|
case Bytecodes::_fadd : arithmetic_op(floatType , code); break;
|
|
case Bytecodes::_dadd : arithmetic_op(doubleType, code); break;
|
|
case Bytecodes::_isub : arithmetic_op(intType , code); break;
|
|
case Bytecodes::_lsub : arithmetic_op(longType , code); break;
|
|
case Bytecodes::_fsub : arithmetic_op(floatType , code); break;
|
|
case Bytecodes::_dsub : arithmetic_op(doubleType, code); break;
|
|
case Bytecodes::_imul : arithmetic_op(intType , code); break;
|
|
case Bytecodes::_lmul : arithmetic_op(longType , code); break;
|
|
case Bytecodes::_fmul : arithmetic_op(floatType , code); break;
|
|
case Bytecodes::_dmul : arithmetic_op(doubleType, code); break;
|
|
case Bytecodes::_idiv : arithmetic_op(intType , code, lock_stack()); break;
|
|
case Bytecodes::_ldiv : arithmetic_op(longType , code, lock_stack()); break;
|
|
case Bytecodes::_fdiv : arithmetic_op(floatType , code); break;
|
|
case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break;
|
|
case Bytecodes::_irem : arithmetic_op(intType , code, lock_stack()); break;
|
|
case Bytecodes::_lrem : arithmetic_op(longType , code, lock_stack()); break;
|
|
case Bytecodes::_frem : arithmetic_op(floatType , code); break;
|
|
case Bytecodes::_drem : arithmetic_op(doubleType, code); break;
|
|
case Bytecodes::_ineg : negate_op(intType ); break;
|
|
case Bytecodes::_lneg : negate_op(longType ); break;
|
|
case Bytecodes::_fneg : negate_op(floatType ); break;
|
|
case Bytecodes::_dneg : negate_op(doubleType); break;
|
|
case Bytecodes::_ishl : shift_op(intType , code); break;
|
|
case Bytecodes::_lshl : shift_op(longType, code); break;
|
|
case Bytecodes::_ishr : shift_op(intType , code); break;
|
|
case Bytecodes::_lshr : shift_op(longType, code); break;
|
|
case Bytecodes::_iushr : shift_op(intType , code); break;
|
|
case Bytecodes::_lushr : shift_op(longType, code); break;
|
|
case Bytecodes::_iand : logic_op(intType , code); break;
|
|
case Bytecodes::_land : logic_op(longType, code); break;
|
|
case Bytecodes::_ior : logic_op(intType , code); break;
|
|
case Bytecodes::_lor : logic_op(longType, code); break;
|
|
case Bytecodes::_ixor : logic_op(intType , code); break;
|
|
case Bytecodes::_lxor : logic_op(longType, code); break;
|
|
case Bytecodes::_iinc : increment(); break;
|
|
case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break;
|
|
case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break;
|
|
case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break;
|
|
case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break;
|
|
case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break;
|
|
case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break;
|
|
case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break;
|
|
case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break;
|
|
case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break;
|
|
case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break;
|
|
case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break;
|
|
case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break;
|
|
case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break;
|
|
case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break;
|
|
case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break;
|
|
case Bytecodes::_lcmp : compare_op(longType , code); break;
|
|
case Bytecodes::_fcmpl : compare_op(floatType , code); break;
|
|
case Bytecodes::_fcmpg : compare_op(floatType , code); break;
|
|
case Bytecodes::_dcmpl : compare_op(doubleType, code); break;
|
|
case Bytecodes::_dcmpg : compare_op(doubleType, code); break;
|
|
case Bytecodes::_ifeq : if_zero(intType , If::eql); break;
|
|
case Bytecodes::_ifne : if_zero(intType , If::neq); break;
|
|
case Bytecodes::_iflt : if_zero(intType , If::lss); break;
|
|
case Bytecodes::_ifge : if_zero(intType , If::geq); break;
|
|
case Bytecodes::_ifgt : if_zero(intType , If::gtr); break;
|
|
case Bytecodes::_ifle : if_zero(intType , If::leq); break;
|
|
case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break;
|
|
case Bytecodes::_if_icmpne : if_same(intType , If::neq); break;
|
|
case Bytecodes::_if_icmplt : if_same(intType , If::lss); break;
|
|
case Bytecodes::_if_icmpge : if_same(intType , If::geq); break;
|
|
case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break;
|
|
case Bytecodes::_if_icmple : if_same(intType , If::leq); break;
|
|
case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break;
|
|
case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break;
|
|
case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break;
|
|
case Bytecodes::_jsr : jsr(s.get_dest()); break;
|
|
case Bytecodes::_ret : ret(s.get_index()); break;
|
|
case Bytecodes::_tableswitch : table_switch(); break;
|
|
case Bytecodes::_lookupswitch : lookup_switch(); break;
|
|
case Bytecodes::_ireturn : method_return(ipop()); break;
|
|
case Bytecodes::_lreturn : method_return(lpop()); break;
|
|
case Bytecodes::_freturn : method_return(fpop()); break;
|
|
case Bytecodes::_dreturn : method_return(dpop()); break;
|
|
case Bytecodes::_areturn : method_return(apop()); break;
|
|
case Bytecodes::_return : method_return(NULL ); break;
|
|
case Bytecodes::_getstatic : // fall through
|
|
case Bytecodes::_putstatic : // fall through
|
|
case Bytecodes::_getfield : // fall through
|
|
case Bytecodes::_putfield : access_field(code); break;
|
|
case Bytecodes::_invokevirtual : // fall through
|
|
case Bytecodes::_invokespecial : // fall through
|
|
case Bytecodes::_invokestatic : // fall through
|
|
case Bytecodes::_invokedynamic : // fall through
|
|
case Bytecodes::_invokeinterface: invoke(code); break;
|
|
case Bytecodes::_new : new_instance(s.get_index_big()); break;
|
|
case Bytecodes::_newarray : new_type_array(); break;
|
|
case Bytecodes::_anewarray : new_object_array(); break;
|
|
case Bytecodes::_arraylength : ipush(append(new ArrayLength(apop(), lock_stack()))); break;
|
|
case Bytecodes::_athrow : throw_op(s.cur_bci()); break;
|
|
case Bytecodes::_checkcast : check_cast(s.get_index_big()); break;
|
|
case Bytecodes::_instanceof : instance_of(s.get_index_big()); break;
|
|
// Note: we do not have special handling for the monitorenter bytecode if DeoptC1 && DeoptOnAsyncException
|
|
case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break;
|
|
case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break;
|
|
case Bytecodes::_wide : ShouldNotReachHere(); break;
|
|
case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break;
|
|
case Bytecodes::_ifnull : if_null(objectType, If::eql); break;
|
|
case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break;
|
|
case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break;
|
|
case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break;
|
|
case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL);
|
|
default : ShouldNotReachHere(); break;
|
|
}
|
|
// save current bci to setup Goto at the end
|
|
prev_bci = s.cur_bci();
|
|
}
|
|
CHECK_BAILOUT_(NULL);
|
|
// stop processing of this block (see try_inline_full)
|
|
if (_skip_block) {
|
|
_skip_block = false;
|
|
assert(_last && _last->as_BlockEnd(), "");
|
|
return _last->as_BlockEnd();
|
|
}
|
|
// if there are any, check if last instruction is a BlockEnd instruction
|
|
BlockEnd* end = last()->as_BlockEnd();
|
|
if (end == NULL) {
|
|
// all blocks must end with a BlockEnd instruction => add a Goto
|
|
end = new Goto(block_at(s.cur_bci()), false);
|
|
_last = _last->set_next(end, prev_bci);
|
|
}
|
|
assert(end == last()->as_BlockEnd(), "inconsistency");
|
|
|
|
// if the method terminates, we don't need the stack anymore
|
|
if (end->as_Return() != NULL) {
|
|
state()->clear_stack();
|
|
} else if (end->as_Throw() != NULL) {
|
|
// May have exception handler in caller scopes
|
|
state()->truncate_stack(scope()->lock_stack_size());
|
|
}
|
|
|
|
// connect to begin & set state
|
|
// NOTE that inlining may have changed the block we are parsing
|
|
block()->set_end(end);
|
|
end->set_state(state());
|
|
// propagate state
|
|
for (int i = end->number_of_sux() - 1; i >= 0; i--) {
|
|
BlockBegin* sux = end->sux_at(i);
|
|
assert(sux->is_predecessor(block()), "predecessor missing");
|
|
// be careful, bailout if bytecodes are strange
|
|
if (!sux->try_merge(state())) BAILOUT_("block join failed", NULL);
|
|
scope_data()->add_to_work_list(end->sux_at(i));
|
|
}
|
|
|
|
scope_data()->set_stream(NULL);
|
|
|
|
// done
|
|
return end;
|
|
}
|
|
|
|
|
|
void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) {
|
|
do {
|
|
if (start_in_current_block_for_inlining && !bailed_out()) {
|
|
iterate_bytecodes_for_block(0);
|
|
start_in_current_block_for_inlining = false;
|
|
} else {
|
|
BlockBegin* b;
|
|
while ((b = scope_data()->remove_from_work_list()) != NULL) {
|
|
if (!b->is_set(BlockBegin::was_visited_flag)) {
|
|
if (b->is_set(BlockBegin::osr_entry_flag)) {
|
|
// we're about to parse the osr entry block, so make sure
|
|
// we setup the OSR edge leading into this block so that
|
|
// Phis get setup correctly.
|
|
setup_osr_entry_block();
|
|
// this is no longer the osr entry block, so clear it.
|
|
b->clear(BlockBegin::osr_entry_flag);
|
|
}
|
|
b->set(BlockBegin::was_visited_flag);
|
|
connect_to_end(b);
|
|
}
|
|
}
|
|
}
|
|
} while (!bailed_out() && !scope_data()->is_work_list_empty());
|
|
}
|
|
|
|
|
|
bool GraphBuilder::_is_initialized = false;
|
|
bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes];
|
|
bool GraphBuilder::_is_async[Bytecodes::number_of_java_codes];
|
|
|
|
void GraphBuilder::initialize() {
|
|
// make sure initialization happens only once (need a
|
|
// lock here, if we allow the compiler to be re-entrant)
|
|
if (is_initialized()) return;
|
|
_is_initialized = true;
|
|
|
|
// the following bytecodes are assumed to potentially
|
|
// throw exceptions in compiled code - note that e.g.
|
|
// monitorexit & the return bytecodes do not throw
|
|
// exceptions since monitor pairing proved that they
|
|
// succeed (if monitor pairing succeeded)
|
|
Bytecodes::Code can_trap_list[] =
|
|
{ Bytecodes::_ldc
|
|
, Bytecodes::_ldc_w
|
|
, Bytecodes::_ldc2_w
|
|
, Bytecodes::_iaload
|
|
, Bytecodes::_laload
|
|
, Bytecodes::_faload
|
|
, Bytecodes::_daload
|
|
, Bytecodes::_aaload
|
|
, Bytecodes::_baload
|
|
, Bytecodes::_caload
|
|
, Bytecodes::_saload
|
|
, Bytecodes::_iastore
|
|
, Bytecodes::_lastore
|
|
, Bytecodes::_fastore
|
|
, Bytecodes::_dastore
|
|
, Bytecodes::_aastore
|
|
, Bytecodes::_bastore
|
|
, Bytecodes::_castore
|
|
, Bytecodes::_sastore
|
|
, Bytecodes::_idiv
|
|
, Bytecodes::_ldiv
|
|
, Bytecodes::_irem
|
|
, Bytecodes::_lrem
|
|
, Bytecodes::_getstatic
|
|
, Bytecodes::_putstatic
|
|
, Bytecodes::_getfield
|
|
, Bytecodes::_putfield
|
|
, Bytecodes::_invokevirtual
|
|
, Bytecodes::_invokespecial
|
|
, Bytecodes::_invokestatic
|
|
, Bytecodes::_invokedynamic
|
|
, Bytecodes::_invokeinterface
|
|
, Bytecodes::_new
|
|
, Bytecodes::_newarray
|
|
, Bytecodes::_anewarray
|
|
, Bytecodes::_arraylength
|
|
, Bytecodes::_athrow
|
|
, Bytecodes::_checkcast
|
|
, Bytecodes::_instanceof
|
|
, Bytecodes::_monitorenter
|
|
, Bytecodes::_multianewarray
|
|
};
|
|
|
|
// the following bytecodes are assumed to potentially
|
|
// throw asynchronous exceptions in compiled code due
|
|
// to safepoints (note: these entries could be merged
|
|
// with the can_trap_list - however, we need to know
|
|
// which ones are asynchronous for now - see also the
|
|
// comment in GraphBuilder::handle_exception)
|
|
Bytecodes::Code is_async_list[] =
|
|
{ Bytecodes::_ifeq
|
|
, Bytecodes::_ifne
|
|
, Bytecodes::_iflt
|
|
, Bytecodes::_ifge
|
|
, Bytecodes::_ifgt
|
|
, Bytecodes::_ifle
|
|
, Bytecodes::_if_icmpeq
|
|
, Bytecodes::_if_icmpne
|
|
, Bytecodes::_if_icmplt
|
|
, Bytecodes::_if_icmpge
|
|
, Bytecodes::_if_icmpgt
|
|
, Bytecodes::_if_icmple
|
|
, Bytecodes::_if_acmpeq
|
|
, Bytecodes::_if_acmpne
|
|
, Bytecodes::_goto
|
|
, Bytecodes::_jsr
|
|
, Bytecodes::_ret
|
|
, Bytecodes::_tableswitch
|
|
, Bytecodes::_lookupswitch
|
|
, Bytecodes::_ireturn
|
|
, Bytecodes::_lreturn
|
|
, Bytecodes::_freturn
|
|
, Bytecodes::_dreturn
|
|
, Bytecodes::_areturn
|
|
, Bytecodes::_return
|
|
, Bytecodes::_ifnull
|
|
, Bytecodes::_ifnonnull
|
|
, Bytecodes::_goto_w
|
|
, Bytecodes::_jsr_w
|
|
};
|
|
|
|
// inititialize trap tables
|
|
for (int i = 0; i < Bytecodes::number_of_java_codes; i++) {
|
|
_can_trap[i] = false;
|
|
_is_async[i] = false;
|
|
}
|
|
// set standard trap info
|
|
for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) {
|
|
_can_trap[can_trap_list[j]] = true;
|
|
}
|
|
|
|
// We now deoptimize if an asynchronous exception is thrown. This
|
|
// considerably cleans up corner case issues related to javac's
|
|
// incorrect exception handler ranges for async exceptions and
|
|
// allows us to precisely analyze the types of exceptions from
|
|
// certain bytecodes.
|
|
if (!(DeoptC1 && DeoptOnAsyncException)) {
|
|
// set asynchronous trap info
|
|
for (uint k = 0; k < ARRAY_SIZE(is_async_list); k++) {
|
|
assert(!_can_trap[is_async_list[k]], "can_trap_list and is_async_list should be disjoint");
|
|
_can_trap[is_async_list[k]] = true;
|
|
_is_async[is_async_list[k]] = true;
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) {
|
|
assert(entry->is_set(f), "entry/flag mismatch");
|
|
// create header block
|
|
BlockBegin* h = new BlockBegin(entry->bci());
|
|
h->set_depth_first_number(0);
|
|
|
|
Value l = h;
|
|
if (profile_branches()) {
|
|
// Increment the invocation count on entry to the method. We
|
|
// can't use profile_invocation here because append isn't setup to
|
|
// work properly at this point. The instruction have to be
|
|
// appended to the instruction stream by hand.
|
|
Value m = new Constant(new ObjectConstant(compilation()->method()));
|
|
h->set_next(m, 0);
|
|
Value p = new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1);
|
|
m->set_next(p, 0);
|
|
l = p;
|
|
}
|
|
|
|
BlockEnd* g = new Goto(entry, false);
|
|
l->set_next(g, entry->bci());
|
|
h->set_end(g);
|
|
h->set(f);
|
|
// setup header block end state
|
|
ValueStack* s = state->copy(); // can use copy since stack is empty (=> no phis)
|
|
assert(s->stack_is_empty(), "must have empty stack at entry point");
|
|
g->set_state(s);
|
|
return h;
|
|
}
|
|
|
|
|
|
|
|
BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) {
|
|
BlockBegin* start = new BlockBegin(0);
|
|
|
|
// This code eliminates the empty start block at the beginning of
|
|
// each method. Previously, each method started with the
|
|
// start-block created below, and this block was followed by the
|
|
// header block that was always empty. This header block is only
|
|
// necesary if std_entry is also a backward branch target because
|
|
// then phi functions may be necessary in the header block. It's
|
|
// also necessary when profiling so that there's a single block that
|
|
// can increment the interpreter_invocation_count.
|
|
BlockBegin* new_header_block;
|
|
if (std_entry->number_of_preds() == 0 && !profile_branches()) {
|
|
new_header_block = std_entry;
|
|
} else {
|
|
new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state);
|
|
}
|
|
|
|
// setup start block (root for the IR graph)
|
|
Base* base =
|
|
new Base(
|
|
new_header_block,
|
|
osr_entry
|
|
);
|
|
start->set_next(base, 0);
|
|
start->set_end(base);
|
|
// create & setup state for start block
|
|
start->set_state(state->copy());
|
|
base->set_state(state->copy());
|
|
|
|
if (base->std_entry()->state() == NULL) {
|
|
// setup states for header blocks
|
|
base->std_entry()->merge(state);
|
|
}
|
|
|
|
assert(base->std_entry()->state() != NULL, "");
|
|
return start;
|
|
}
|
|
|
|
|
|
void GraphBuilder::setup_osr_entry_block() {
|
|
assert(compilation()->is_osr_compile(), "only for osrs");
|
|
|
|
int osr_bci = compilation()->osr_bci();
|
|
ciBytecodeStream s(method());
|
|
s.reset_to_bci(osr_bci);
|
|
s.next();
|
|
scope_data()->set_stream(&s);
|
|
|
|
// create a new block to be the osr setup code
|
|
_osr_entry = new BlockBegin(osr_bci);
|
|
_osr_entry->set(BlockBegin::osr_entry_flag);
|
|
_osr_entry->set_depth_first_number(0);
|
|
BlockBegin* target = bci2block()->at(osr_bci);
|
|
assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there");
|
|
// the osr entry has no values for locals
|
|
ValueStack* state = target->state()->copy();
|
|
_osr_entry->set_state(state);
|
|
|
|
kill_all();
|
|
_block = _osr_entry;
|
|
_state = _osr_entry->state()->copy();
|
|
_last = _osr_entry;
|
|
Value e = append(new OsrEntry());
|
|
e->set_needs_null_check(false);
|
|
|
|
// OSR buffer is
|
|
//
|
|
// locals[nlocals-1..0]
|
|
// monitors[number_of_locks-1..0]
|
|
//
|
|
// locals is a direct copy of the interpreter frame so in the osr buffer
|
|
// so first slot in the local array is the last local from the interpreter
|
|
// and last slot is local[0] (receiver) from the interpreter
|
|
//
|
|
// Similarly with locks. The first lock slot in the osr buffer is the nth lock
|
|
// from the interpreter frame, the nth lock slot in the osr buffer is 0th lock
|
|
// in the interpreter frame (the method lock if a sync method)
|
|
|
|
// Initialize monitors in the compiled activation.
|
|
|
|
int index;
|
|
Value local;
|
|
|
|
// find all the locals that the interpreter thinks contain live oops
|
|
const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci);
|
|
|
|
// compute the offset into the locals so that we can treat the buffer
|
|
// as if the locals were still in the interpreter frame
|
|
int locals_offset = BytesPerWord * (method()->max_locals() - 1);
|
|
for_each_local_value(state, index, local) {
|
|
int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord;
|
|
Value get;
|
|
if (local->type()->is_object_kind() && !live_oops.at(index)) {
|
|
// The interpreter thinks this local is dead but the compiler
|
|
// doesn't so pretend that the interpreter passed in null.
|
|
get = append(new Constant(objectNull));
|
|
} else {
|
|
get = append(new UnsafeGetRaw(as_BasicType(local->type()), e,
|
|
append(new Constant(new IntConstant(offset))),
|
|
0,
|
|
true));
|
|
}
|
|
_state->store_local(index, get);
|
|
}
|
|
|
|
// the storage for the OSR buffer is freed manually in the LIRGenerator.
|
|
|
|
assert(state->caller_state() == NULL, "should be top scope");
|
|
state->clear_locals();
|
|
Goto* g = new Goto(target, false);
|
|
g->set_state(_state->copy());
|
|
append(g);
|
|
_osr_entry->set_end(g);
|
|
target->merge(_osr_entry->end()->state());
|
|
|
|
scope_data()->set_stream(NULL);
|
|
}
|
|
|
|
|
|
ValueStack* GraphBuilder::state_at_entry() {
|
|
ValueStack* state = new ValueStack(scope(), method()->max_locals(), method()->max_stack());
|
|
|
|
// Set up locals for receiver
|
|
int idx = 0;
|
|
if (!method()->is_static()) {
|
|
// we should always see the receiver
|
|
state->store_local(idx, new Local(objectType, idx));
|
|
idx = 1;
|
|
}
|
|
|
|
// Set up locals for incoming arguments
|
|
ciSignature* sig = method()->signature();
|
|
for (int i = 0; i < sig->count(); i++) {
|
|
ciType* type = sig->type_at(i);
|
|
BasicType basic_type = type->basic_type();
|
|
// don't allow T_ARRAY to propagate into locals types
|
|
if (basic_type == T_ARRAY) basic_type = T_OBJECT;
|
|
ValueType* vt = as_ValueType(basic_type);
|
|
state->store_local(idx, new Local(vt, idx));
|
|
idx += type->size();
|
|
}
|
|
|
|
// lock synchronized method
|
|
if (method()->is_synchronized()) {
|
|
state->lock(scope(), NULL);
|
|
}
|
|
|
|
return state;
|
|
}
|
|
|
|
|
|
GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope)
|
|
: _scope_data(NULL)
|
|
, _exception_state(NULL)
|
|
, _instruction_count(0)
|
|
, _osr_entry(NULL)
|
|
, _memory(new MemoryBuffer())
|
|
, _compilation(compilation)
|
|
, _inline_bailout_msg(NULL)
|
|
{
|
|
int osr_bci = compilation->osr_bci();
|
|
|
|
// determine entry points and bci2block mapping
|
|
BlockListBuilder blm(compilation, scope, osr_bci);
|
|
CHECK_BAILOUT();
|
|
|
|
BlockList* bci2block = blm.bci2block();
|
|
BlockBegin* start_block = bci2block->at(0);
|
|
|
|
assert(is_initialized(), "GraphBuilder must have been initialized");
|
|
push_root_scope(scope, bci2block, start_block);
|
|
|
|
// setup state for std entry
|
|
_initial_state = state_at_entry();
|
|
start_block->merge(_initial_state);
|
|
|
|
// complete graph
|
|
_vmap = new ValueMap();
|
|
scope->compute_lock_stack_size();
|
|
switch (scope->method()->intrinsic_id()) {
|
|
case vmIntrinsics::_dabs : // fall through
|
|
case vmIntrinsics::_dsqrt : // fall through
|
|
case vmIntrinsics::_dsin : // fall through
|
|
case vmIntrinsics::_dcos : // fall through
|
|
case vmIntrinsics::_dtan : // fall through
|
|
case vmIntrinsics::_dlog : // fall through
|
|
case vmIntrinsics::_dlog10 : // fall through
|
|
{
|
|
// Compiles where the root method is an intrinsic need a special
|
|
// compilation environment because the bytecodes for the method
|
|
// shouldn't be parsed during the compilation, only the special
|
|
// Intrinsic node should be emitted. If this isn't done the the
|
|
// code for the inlined version will be different than the root
|
|
// compiled version which could lead to monotonicity problems on
|
|
// intel.
|
|
|
|
// Set up a stream so that appending instructions works properly.
|
|
ciBytecodeStream s(scope->method());
|
|
s.reset_to_bci(0);
|
|
scope_data()->set_stream(&s);
|
|
s.next();
|
|
|
|
// setup the initial block state
|
|
_block = start_block;
|
|
_state = start_block->state()->copy();
|
|
_last = start_block;
|
|
load_local(doubleType, 0);
|
|
|
|
// Emit the intrinsic node.
|
|
bool result = try_inline_intrinsics(scope->method());
|
|
if (!result) BAILOUT("failed to inline intrinsic");
|
|
method_return(dpop());
|
|
|
|
// connect the begin and end blocks and we're all done.
|
|
BlockEnd* end = last()->as_BlockEnd();
|
|
block()->set_end(end);
|
|
end->set_state(state());
|
|
break;
|
|
}
|
|
default:
|
|
scope_data()->add_to_work_list(start_block);
|
|
iterate_all_blocks();
|
|
break;
|
|
}
|
|
CHECK_BAILOUT();
|
|
|
|
_start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state);
|
|
|
|
eliminate_redundant_phis(_start);
|
|
|
|
NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats());
|
|
// for osr compile, bailout if some requirements are not fulfilled
|
|
if (osr_bci != -1) {
|
|
BlockBegin* osr_block = blm.bci2block()->at(osr_bci);
|
|
assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile");
|
|
|
|
// check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points
|
|
if (!osr_block->state()->stack_is_empty()) {
|
|
BAILOUT("stack not empty at OSR entry point");
|
|
}
|
|
}
|
|
#ifndef PRODUCT
|
|
if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count);
|
|
#endif
|
|
}
|
|
|
|
|
|
ValueStack* GraphBuilder::lock_stack() {
|
|
// return a new ValueStack representing just the current lock stack
|
|
// (for debug info at safepoints in exception throwing or handling)
|
|
ValueStack* new_stack = state()->copy_locks();
|
|
return new_stack;
|
|
}
|
|
|
|
|
|
int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const {
|
|
int recur_level = 0;
|
|
for (IRScope* s = scope(); s != NULL; s = s->caller()) {
|
|
if (s->method() == cur_callee) {
|
|
++recur_level;
|
|
}
|
|
}
|
|
return recur_level;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) {
|
|
// Clear out any existing inline bailout condition
|
|
clear_inline_bailout();
|
|
|
|
if (callee->should_exclude()) {
|
|
// callee is excluded
|
|
INLINE_BAILOUT("excluded by CompilerOracle")
|
|
} else if (!callee->can_be_compiled()) {
|
|
// callee is not compilable (prob. has breakpoints)
|
|
INLINE_BAILOUT("not compilable")
|
|
} else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) {
|
|
// intrinsics can be native or not
|
|
return true;
|
|
} else if (callee->is_native()) {
|
|
// non-intrinsic natives cannot be inlined
|
|
INLINE_BAILOUT("non-intrinsic native")
|
|
} else if (callee->is_abstract()) {
|
|
INLINE_BAILOUT("abstract")
|
|
} else {
|
|
return try_inline_full(callee, holder_known);
|
|
}
|
|
}
|
|
|
|
|
|
bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) {
|
|
if (!InlineNatives ) INLINE_BAILOUT("intrinsic method inlining disabled");
|
|
if (callee->is_synchronized()) INLINE_BAILOUT("intrinsic method is synchronized");
|
|
// callee seems like a good candidate
|
|
// determine id
|
|
bool preserves_state = false;
|
|
bool cantrap = true;
|
|
vmIntrinsics::ID id = callee->intrinsic_id();
|
|
switch (id) {
|
|
case vmIntrinsics::_arraycopy :
|
|
if (!InlineArrayCopy) return false;
|
|
break;
|
|
|
|
case vmIntrinsics::_currentTimeMillis:
|
|
case vmIntrinsics::_nanoTime:
|
|
preserves_state = true;
|
|
cantrap = false;
|
|
break;
|
|
|
|
case vmIntrinsics::_floatToRawIntBits :
|
|
case vmIntrinsics::_intBitsToFloat :
|
|
case vmIntrinsics::_doubleToRawLongBits :
|
|
case vmIntrinsics::_longBitsToDouble :
|
|
if (!InlineMathNatives) return false;
|
|
preserves_state = true;
|
|
cantrap = false;
|
|
break;
|
|
|
|
case vmIntrinsics::_getClass :
|
|
if (!InlineClassNatives) return false;
|
|
preserves_state = true;
|
|
break;
|
|
|
|
case vmIntrinsics::_currentThread :
|
|
if (!InlineThreadNatives) return false;
|
|
preserves_state = true;
|
|
cantrap = false;
|
|
break;
|
|
|
|
case vmIntrinsics::_dabs : // fall through
|
|
case vmIntrinsics::_dsqrt : // fall through
|
|
case vmIntrinsics::_dsin : // fall through
|
|
case vmIntrinsics::_dcos : // fall through
|
|
case vmIntrinsics::_dtan : // fall through
|
|
case vmIntrinsics::_dlog : // fall through
|
|
case vmIntrinsics::_dlog10 : // fall through
|
|
if (!InlineMathNatives) return false;
|
|
cantrap = false;
|
|
preserves_state = true;
|
|
break;
|
|
|
|
// sun/misc/AtomicLong.attemptUpdate
|
|
case vmIntrinsics::_attemptUpdate :
|
|
if (!VM_Version::supports_cx8()) return false;
|
|
if (!InlineAtomicLong) return false;
|
|
preserves_state = true;
|
|
break;
|
|
|
|
// Use special nodes for Unsafe instructions so we can more easily
|
|
// perform an address-mode optimization on the raw variants
|
|
case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT, false);
|
|
case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false);
|
|
case vmIntrinsics::_getByte : return append_unsafe_get_obj(callee, T_BYTE, false);
|
|
case vmIntrinsics::_getShort : return append_unsafe_get_obj(callee, T_SHORT, false);
|
|
case vmIntrinsics::_getChar : return append_unsafe_get_obj(callee, T_CHAR, false);
|
|
case vmIntrinsics::_getInt : return append_unsafe_get_obj(callee, T_INT, false);
|
|
case vmIntrinsics::_getLong : return append_unsafe_get_obj(callee, T_LONG, false);
|
|
case vmIntrinsics::_getFloat : return append_unsafe_get_obj(callee, T_FLOAT, false);
|
|
case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE, false);
|
|
|
|
case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT, false);
|
|
case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false);
|
|
case vmIntrinsics::_putByte : return append_unsafe_put_obj(callee, T_BYTE, false);
|
|
case vmIntrinsics::_putShort : return append_unsafe_put_obj(callee, T_SHORT, false);
|
|
case vmIntrinsics::_putChar : return append_unsafe_put_obj(callee, T_CHAR, false);
|
|
case vmIntrinsics::_putInt : return append_unsafe_put_obj(callee, T_INT, false);
|
|
case vmIntrinsics::_putLong : return append_unsafe_put_obj(callee, T_LONG, false);
|
|
case vmIntrinsics::_putFloat : return append_unsafe_put_obj(callee, T_FLOAT, false);
|
|
case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE, false);
|
|
|
|
case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT, true);
|
|
case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true);
|
|
case vmIntrinsics::_getByteVolatile : return append_unsafe_get_obj(callee, T_BYTE, true);
|
|
case vmIntrinsics::_getShortVolatile : return append_unsafe_get_obj(callee, T_SHORT, true);
|
|
case vmIntrinsics::_getCharVolatile : return append_unsafe_get_obj(callee, T_CHAR, true);
|
|
case vmIntrinsics::_getIntVolatile : return append_unsafe_get_obj(callee, T_INT, true);
|
|
case vmIntrinsics::_getLongVolatile : return append_unsafe_get_obj(callee, T_LONG, true);
|
|
case vmIntrinsics::_getFloatVolatile : return append_unsafe_get_obj(callee, T_FLOAT, true);
|
|
case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE, true);
|
|
|
|
case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT, true);
|
|
case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true);
|
|
case vmIntrinsics::_putByteVolatile : return append_unsafe_put_obj(callee, T_BYTE, true);
|
|
case vmIntrinsics::_putShortVolatile : return append_unsafe_put_obj(callee, T_SHORT, true);
|
|
case vmIntrinsics::_putCharVolatile : return append_unsafe_put_obj(callee, T_CHAR, true);
|
|
case vmIntrinsics::_putIntVolatile : return append_unsafe_put_obj(callee, T_INT, true);
|
|
case vmIntrinsics::_putLongVolatile : return append_unsafe_put_obj(callee, T_LONG, true);
|
|
case vmIntrinsics::_putFloatVolatile : return append_unsafe_put_obj(callee, T_FLOAT, true);
|
|
case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE, true);
|
|
|
|
case vmIntrinsics::_getByte_raw : return append_unsafe_get_raw(callee, T_BYTE);
|
|
case vmIntrinsics::_getShort_raw : return append_unsafe_get_raw(callee, T_SHORT);
|
|
case vmIntrinsics::_getChar_raw : return append_unsafe_get_raw(callee, T_CHAR);
|
|
case vmIntrinsics::_getInt_raw : return append_unsafe_get_raw(callee, T_INT);
|
|
case vmIntrinsics::_getLong_raw : return append_unsafe_get_raw(callee, T_LONG);
|
|
case vmIntrinsics::_getFloat_raw : return append_unsafe_get_raw(callee, T_FLOAT);
|
|
case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE);
|
|
|
|
case vmIntrinsics::_putByte_raw : return append_unsafe_put_raw(callee, T_BYTE);
|
|
case vmIntrinsics::_putShort_raw : return append_unsafe_put_raw(callee, T_SHORT);
|
|
case vmIntrinsics::_putChar_raw : return append_unsafe_put_raw(callee, T_CHAR);
|
|
case vmIntrinsics::_putInt_raw : return append_unsafe_put_raw(callee, T_INT);
|
|
case vmIntrinsics::_putLong_raw : return append_unsafe_put_raw(callee, T_LONG);
|
|
case vmIntrinsics::_putFloat_raw : return append_unsafe_put_raw(callee, T_FLOAT);
|
|
case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE);
|
|
|
|
case vmIntrinsics::_prefetchRead : return append_unsafe_prefetch(callee, false, false);
|
|
case vmIntrinsics::_prefetchWrite : return append_unsafe_prefetch(callee, false, true);
|
|
case vmIntrinsics::_prefetchReadStatic : return append_unsafe_prefetch(callee, true, false);
|
|
case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true, true);
|
|
|
|
case vmIntrinsics::_checkIndex :
|
|
if (!InlineNIOCheckIndex) return false;
|
|
preserves_state = true;
|
|
break;
|
|
case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT, true);
|
|
case vmIntrinsics::_putOrderedInt : return append_unsafe_put_obj(callee, T_INT, true);
|
|
case vmIntrinsics::_putOrderedLong : return append_unsafe_put_obj(callee, T_LONG, true);
|
|
|
|
case vmIntrinsics::_compareAndSwapLong:
|
|
if (!VM_Version::supports_cx8()) return false;
|
|
// fall through
|
|
case vmIntrinsics::_compareAndSwapInt:
|
|
case vmIntrinsics::_compareAndSwapObject:
|
|
append_unsafe_CAS(callee);
|
|
return true;
|
|
|
|
default : return false; // do not inline
|
|
}
|
|
// create intrinsic node
|
|
const bool has_receiver = !callee->is_static();
|
|
ValueType* result_type = as_ValueType(callee->return_type());
|
|
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
ValueStack* locks = lock_stack();
|
|
if (profile_calls()) {
|
|
// Don't profile in the special case where the root method
|
|
// is the intrinsic
|
|
if (callee != method()) {
|
|
Value recv = NULL;
|
|
if (has_receiver) {
|
|
recv = args->at(0);
|
|
null_check(recv);
|
|
}
|
|
profile_call(recv, NULL);
|
|
}
|
|
}
|
|
|
|
Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, lock_stack(),
|
|
preserves_state, cantrap);
|
|
// append instruction & push result
|
|
Value value = append_split(result);
|
|
if (result_type != voidType) push(result_type, value);
|
|
|
|
#ifndef PRODUCT
|
|
// printing
|
|
if (PrintInlining) {
|
|
print_inline_result(callee, true);
|
|
}
|
|
#endif
|
|
|
|
// done
|
|
return true;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) {
|
|
// Introduce a new callee continuation point - all Ret instructions
|
|
// will be replaced with Gotos to this point.
|
|
BlockBegin* cont = block_at(next_bci());
|
|
assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr");
|
|
|
|
// Note: can not assign state to continuation yet, as we have to
|
|
// pick up the state from the Ret instructions.
|
|
|
|
// Push callee scope
|
|
push_scope_for_jsr(cont, jsr_dest_bci);
|
|
|
|
// Temporarily set up bytecode stream so we can append instructions
|
|
// (only using the bci of this stream)
|
|
scope_data()->set_stream(scope_data()->parent()->stream());
|
|
|
|
BlockBegin* jsr_start_block = block_at(jsr_dest_bci);
|
|
assert(jsr_start_block != NULL, "jsr start block must exist");
|
|
assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet");
|
|
Goto* goto_sub = new Goto(jsr_start_block, false);
|
|
goto_sub->set_state(state());
|
|
// Must copy state to avoid wrong sharing when parsing bytecodes
|
|
assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block");
|
|
jsr_start_block->set_state(state()->copy());
|
|
append(goto_sub);
|
|
_block->set_end(goto_sub);
|
|
_last = _block = jsr_start_block;
|
|
|
|
// Clear out bytecode stream
|
|
scope_data()->set_stream(NULL);
|
|
|
|
scope_data()->add_to_work_list(jsr_start_block);
|
|
|
|
// Ready to resume parsing in subroutine
|
|
iterate_all_blocks();
|
|
|
|
// If we bailed out during parsing, return immediately (this is bad news)
|
|
CHECK_BAILOUT_(false);
|
|
|
|
// Detect whether the continuation can actually be reached. If not,
|
|
// it has not had state set by the join() operations in
|
|
// iterate_bytecodes_for_block()/ret() and we should not touch the
|
|
// iteration state. The calling activation of
|
|
// iterate_bytecodes_for_block will then complete normally.
|
|
if (cont->state() != NULL) {
|
|
if (!cont->is_set(BlockBegin::was_visited_flag)) {
|
|
// add continuation to work list instead of parsing it immediately
|
|
scope_data()->parent()->add_to_work_list(cont);
|
|
}
|
|
}
|
|
|
|
assert(jsr_continuation() == cont, "continuation must not have changed");
|
|
assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) ||
|
|
jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag),
|
|
"continuation can only be visited in case of backward branches");
|
|
assert(_last && _last->as_BlockEnd(), "block must have end");
|
|
|
|
// continuation is in work list, so end iteration of current block
|
|
_skip_block = true;
|
|
pop_scope_for_jsr();
|
|
|
|
return true;
|
|
}
|
|
|
|
|
|
// Inline the entry of a synchronized method as a monitor enter and
|
|
// register the exception handler which releases the monitor if an
|
|
// exception is thrown within the callee. Note that the monitor enter
|
|
// cannot throw an exception itself, because the receiver is
|
|
// guaranteed to be non-null by the explicit null check at the
|
|
// beginning of inlining.
|
|
void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) {
|
|
assert(lock != NULL && sync_handler != NULL, "lock or handler missing");
|
|
|
|
set_exception_state(state()->copy());
|
|
monitorenter(lock, SynchronizationEntryBCI);
|
|
assert(_last->as_MonitorEnter() != NULL, "monitor enter expected");
|
|
_last->set_needs_null_check(false);
|
|
|
|
sync_handler->set(BlockBegin::exception_entry_flag);
|
|
sync_handler->set(BlockBegin::is_on_work_list_flag);
|
|
|
|
ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0);
|
|
XHandler* h = new XHandler(desc);
|
|
h->set_entry_block(sync_handler);
|
|
scope_data()->xhandlers()->append(h);
|
|
scope_data()->set_has_handler();
|
|
}
|
|
|
|
|
|
// If an exception is thrown and not handled within an inlined
|
|
// synchronized method, the monitor must be released before the
|
|
// exception is rethrown in the outer scope. Generate the appropriate
|
|
// instructions here.
|
|
void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) {
|
|
BlockBegin* orig_block = _block;
|
|
ValueStack* orig_state = _state;
|
|
Instruction* orig_last = _last;
|
|
_last = _block = sync_handler;
|
|
_state = sync_handler->state()->copy();
|
|
|
|
assert(sync_handler != NULL, "handler missing");
|
|
assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here");
|
|
|
|
assert(lock != NULL || default_handler, "lock or handler missing");
|
|
|
|
XHandler* h = scope_data()->xhandlers()->remove_last();
|
|
assert(h->entry_block() == sync_handler, "corrupt list of handlers");
|
|
|
|
block()->set(BlockBegin::was_visited_flag);
|
|
Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI);
|
|
assert(exception->is_pinned(), "must be");
|
|
|
|
int bci = SynchronizationEntryBCI;
|
|
if (lock) {
|
|
assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing");
|
|
if (lock->bci() == -99) {
|
|
lock = append_with_bci(lock, -1);
|
|
}
|
|
|
|
// exit the monitor in the context of the synchronized method
|
|
monitorexit(lock, SynchronizationEntryBCI);
|
|
|
|
// exit the context of the synchronized method
|
|
if (!default_handler) {
|
|
pop_scope();
|
|
_state = _state->copy();
|
|
bci = _state->scope()->caller_bci();
|
|
_state = _state->pop_scope()->copy();
|
|
}
|
|
}
|
|
|
|
// perform the throw as if at the the call site
|
|
apush(exception);
|
|
|
|
set_exception_state(state()->copy());
|
|
throw_op(bci);
|
|
|
|
BlockEnd* end = last()->as_BlockEnd();
|
|
block()->set_end(end);
|
|
end->set_state(state());
|
|
|
|
_block = orig_block;
|
|
_state = orig_state;
|
|
_last = orig_last;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) {
|
|
assert(!callee->is_native(), "callee must not be native");
|
|
|
|
// first perform tests of things it's not possible to inline
|
|
if (callee->has_exception_handlers() &&
|
|
!InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers");
|
|
if (callee->is_synchronized() &&
|
|
!InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized");
|
|
if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet");
|
|
if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match");
|
|
|
|
// Proper inlining of methods with jsrs requires a little more work.
|
|
if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet");
|
|
|
|
// now perform tests that are based on flag settings
|
|
if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("too-deep inlining");
|
|
if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining");
|
|
if (callee->code_size() > max_inline_size() ) INLINE_BAILOUT("callee is too large");
|
|
|
|
// don't inline throwable methods unless the inlining tree is rooted in a throwable class
|
|
if (callee->name() == ciSymbol::object_initializer_name() &&
|
|
callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) {
|
|
// Throwable constructor call
|
|
IRScope* top = scope();
|
|
while (top->caller() != NULL) {
|
|
top = top->caller();
|
|
}
|
|
if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) {
|
|
INLINE_BAILOUT("don't inline Throwable constructors");
|
|
}
|
|
}
|
|
|
|
// When SSE2 is used on intel, then no special handling is needed
|
|
// for strictfp because the enum-constant is fixed at compile time,
|
|
// the check for UseSSE2 is needed here
|
|
if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) {
|
|
INLINE_BAILOUT("caller and callee have different strict fp requirements");
|
|
}
|
|
|
|
if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) {
|
|
INLINE_BAILOUT("total inlining greater than DesiredMethodLimit");
|
|
}
|
|
|
|
#ifndef PRODUCT
|
|
// printing
|
|
if (PrintInlining) {
|
|
print_inline_result(callee, true);
|
|
}
|
|
#endif
|
|
|
|
// NOTE: Bailouts from this point on, which occur at the
|
|
// GraphBuilder level, do not cause bailout just of the inlining but
|
|
// in fact of the entire compilation.
|
|
|
|
BlockBegin* orig_block = block();
|
|
|
|
const int args_base = state()->stack_size() - callee->arg_size();
|
|
assert(args_base >= 0, "stack underflow during inlining");
|
|
|
|
// Insert null check if necessary
|
|
Value recv = NULL;
|
|
if (code() != Bytecodes::_invokestatic) {
|
|
// note: null check must happen even if first instruction of callee does
|
|
// an implicit null check since the callee is in a different scope
|
|
// and we must make sure exception handling does the right thing
|
|
assert(!callee->is_static(), "callee must not be static");
|
|
assert(callee->arg_size() > 0, "must have at least a receiver");
|
|
recv = state()->stack_at(args_base);
|
|
null_check(recv);
|
|
}
|
|
|
|
if (profile_inlined_calls()) {
|
|
profile_call(recv, holder_known ? callee->holder() : NULL);
|
|
}
|
|
|
|
profile_invocation(callee);
|
|
|
|
// Introduce a new callee continuation point - if the callee has
|
|
// more than one return instruction or the return does not allow
|
|
// fall-through of control flow, all return instructions of the
|
|
// callee will need to be replaced by Goto's pointing to this
|
|
// continuation point.
|
|
BlockBegin* cont = block_at(next_bci());
|
|
bool continuation_existed = true;
|
|
if (cont == NULL) {
|
|
cont = new BlockBegin(next_bci());
|
|
// low number so that continuation gets parsed as early as possible
|
|
cont->set_depth_first_number(0);
|
|
#ifndef PRODUCT
|
|
if (PrintInitialBlockList) {
|
|
tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d",
|
|
cont->block_id(), cont->bci(), bci());
|
|
}
|
|
#endif
|
|
continuation_existed = false;
|
|
}
|
|
// Record number of predecessors of continuation block before
|
|
// inlining, to detect if inlined method has edges to its
|
|
// continuation after inlining.
|
|
int continuation_preds = cont->number_of_preds();
|
|
|
|
// Push callee scope
|
|
push_scope(callee, cont);
|
|
|
|
// the BlockListBuilder for the callee could have bailed out
|
|
CHECK_BAILOUT_(false);
|
|
|
|
// Temporarily set up bytecode stream so we can append instructions
|
|
// (only using the bci of this stream)
|
|
scope_data()->set_stream(scope_data()->parent()->stream());
|
|
|
|
// Pass parameters into callee state: add assignments
|
|
// note: this will also ensure that all arguments are computed before being passed
|
|
ValueStack* callee_state = state();
|
|
ValueStack* caller_state = scope()->caller_state();
|
|
{ int i = args_base;
|
|
while (i < caller_state->stack_size()) {
|
|
const int par_no = i - args_base;
|
|
Value arg = caller_state->stack_at_inc(i);
|
|
// NOTE: take base() of arg->type() to avoid problems storing
|
|
// constants
|
|
store_local(callee_state, arg, arg->type()->base(), par_no);
|
|
}
|
|
}
|
|
|
|
// Remove args from stack.
|
|
// Note that we preserve locals state in case we can use it later
|
|
// (see use of pop_scope() below)
|
|
caller_state->truncate_stack(args_base);
|
|
callee_state->truncate_stack(args_base);
|
|
|
|
// Setup state that is used at returns form the inlined method.
|
|
// This is essentially the state of the continuation block,
|
|
// but without the return value on stack, if any, this will
|
|
// be pushed at the return instruction (see method_return).
|
|
scope_data()->set_continuation_state(caller_state->copy());
|
|
|
|
// Compute lock stack size for callee scope now that args have been passed
|
|
scope()->compute_lock_stack_size();
|
|
|
|
Value lock;
|
|
BlockBegin* sync_handler;
|
|
|
|
// Inline the locking of the receiver if the callee is synchronized
|
|
if (callee->is_synchronized()) {
|
|
lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror())))
|
|
: state()->local_at(0);
|
|
sync_handler = new BlockBegin(-1);
|
|
inline_sync_entry(lock, sync_handler);
|
|
|
|
// recompute the lock stack size
|
|
scope()->compute_lock_stack_size();
|
|
}
|
|
|
|
|
|
BlockBegin* callee_start_block = block_at(0);
|
|
if (callee_start_block != NULL) {
|
|
assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header");
|
|
Goto* goto_callee = new Goto(callee_start_block, false);
|
|
goto_callee->set_state(state());
|
|
// The state for this goto is in the scope of the callee, so use
|
|
// the entry bci for the callee instead of the call site bci.
|
|
append_with_bci(goto_callee, 0);
|
|
_block->set_end(goto_callee);
|
|
callee_start_block->merge(callee_state);
|
|
|
|
_last = _block = callee_start_block;
|
|
|
|
scope_data()->add_to_work_list(callee_start_block);
|
|
}
|
|
|
|
// Clear out bytecode stream
|
|
scope_data()->set_stream(NULL);
|
|
|
|
// Ready to resume parsing in callee (either in the same block we
|
|
// were in before or in the callee's start block)
|
|
iterate_all_blocks(callee_start_block == NULL);
|
|
|
|
// If we bailed out during parsing, return immediately (this is bad news)
|
|
if (bailed_out()) return false;
|
|
|
|
// iterate_all_blocks theoretically traverses in random order; in
|
|
// practice, we have only traversed the continuation if we are
|
|
// inlining into a subroutine
|
|
assert(continuation_existed ||
|
|
!continuation()->is_set(BlockBegin::was_visited_flag),
|
|
"continuation should not have been parsed yet if we created it");
|
|
|
|
// If we bailed out during parsing, return immediately (this is bad news)
|
|
CHECK_BAILOUT_(false);
|
|
|
|
// At this point we are almost ready to return and resume parsing of
|
|
// the caller back in the GraphBuilder. The only thing we want to do
|
|
// first is an optimization: during parsing of the callee we
|
|
// generated at least one Goto to the continuation block. If we
|
|
// generated exactly one, and if the inlined method spanned exactly
|
|
// one block (and we didn't have to Goto its entry), then we snip
|
|
// off the Goto to the continuation, allowing control to fall
|
|
// through back into the caller block and effectively performing
|
|
// block merging. This allows load elimination and CSE to take place
|
|
// across multiple callee scopes if they are relatively simple, and
|
|
// is currently essential to making inlining profitable.
|
|
if ( num_returns() == 1
|
|
&& block() == orig_block
|
|
&& block() == inline_cleanup_block()) {
|
|
_last = inline_cleanup_return_prev();
|
|
_state = inline_cleanup_state()->pop_scope();
|
|
} else if (continuation_preds == cont->number_of_preds()) {
|
|
// Inlining caused that the instructions after the invoke in the
|
|
// caller are not reachable any more. So skip filling this block
|
|
// with instructions!
|
|
assert (cont == continuation(), "");
|
|
assert(_last && _last->as_BlockEnd(), "");
|
|
_skip_block = true;
|
|
} else {
|
|
// Resume parsing in continuation block unless it was already parsed.
|
|
// Note that if we don't change _last here, iteration in
|
|
// iterate_bytecodes_for_block will stop when we return.
|
|
if (!continuation()->is_set(BlockBegin::was_visited_flag)) {
|
|
// add continuation to work list instead of parsing it immediately
|
|
assert(_last && _last->as_BlockEnd(), "");
|
|
scope_data()->parent()->add_to_work_list(continuation());
|
|
_skip_block = true;
|
|
}
|
|
}
|
|
|
|
// Fill the exception handler for synchronized methods with instructions
|
|
if (callee->is_synchronized() && sync_handler->state() != NULL) {
|
|
fill_sync_handler(lock, sync_handler);
|
|
} else {
|
|
pop_scope();
|
|
}
|
|
|
|
compilation()->notice_inlined_method(callee);
|
|
|
|
return true;
|
|
}
|
|
|
|
|
|
void GraphBuilder::inline_bailout(const char* msg) {
|
|
assert(msg != NULL, "inline bailout msg must exist");
|
|
_inline_bailout_msg = msg;
|
|
}
|
|
|
|
|
|
void GraphBuilder::clear_inline_bailout() {
|
|
_inline_bailout_msg = NULL;
|
|
}
|
|
|
|
|
|
void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) {
|
|
ScopeData* data = new ScopeData(NULL);
|
|
data->set_scope(scope);
|
|
data->set_bci2block(bci2block);
|
|
_scope_data = data;
|
|
_block = start;
|
|
}
|
|
|
|
|
|
void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) {
|
|
IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false);
|
|
scope()->add_callee(callee_scope);
|
|
|
|
BlockListBuilder blb(compilation(), callee_scope, -1);
|
|
CHECK_BAILOUT();
|
|
|
|
if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) {
|
|
// this scope can be inlined directly into the caller so remove
|
|
// the block at bci 0.
|
|
blb.bci2block()->at_put(0, NULL);
|
|
}
|
|
|
|
callee_scope->set_caller_state(state());
|
|
set_state(state()->push_scope(callee_scope));
|
|
|
|
ScopeData* data = new ScopeData(scope_data());
|
|
data->set_scope(callee_scope);
|
|
data->set_bci2block(blb.bci2block());
|
|
data->set_continuation(continuation);
|
|
_scope_data = data;
|
|
}
|
|
|
|
|
|
void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) {
|
|
ScopeData* data = new ScopeData(scope_data());
|
|
data->set_parsing_jsr();
|
|
data->set_jsr_entry_bci(jsr_dest_bci);
|
|
data->set_jsr_return_address_local(-1);
|
|
// Must clone bci2block list as we will be mutating it in order to
|
|
// properly clone all blocks in jsr region as well as exception
|
|
// handlers containing rets
|
|
BlockList* new_bci2block = new BlockList(bci2block()->length());
|
|
new_bci2block->push_all(bci2block());
|
|
data->set_bci2block(new_bci2block);
|
|
data->set_scope(scope());
|
|
data->setup_jsr_xhandlers();
|
|
data->set_continuation(continuation());
|
|
if (continuation() != NULL) {
|
|
assert(continuation_state() != NULL, "");
|
|
data->set_continuation_state(continuation_state()->copy());
|
|
}
|
|
data->set_jsr_continuation(jsr_continuation);
|
|
_scope_data = data;
|
|
}
|
|
|
|
|
|
void GraphBuilder::pop_scope() {
|
|
int number_of_locks = scope()->number_of_locks();
|
|
_scope_data = scope_data()->parent();
|
|
// accumulate minimum number of monitor slots to be reserved
|
|
scope()->set_min_number_of_locks(number_of_locks);
|
|
}
|
|
|
|
|
|
void GraphBuilder::pop_scope_for_jsr() {
|
|
_scope_data = scope_data()->parent();
|
|
}
|
|
|
|
bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) {
|
|
if (InlineUnsafeOps) {
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
null_check(args->at(0));
|
|
Instruction* offset = args->at(2);
|
|
#ifndef _LP64
|
|
offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
#endif
|
|
Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile));
|
|
push(op->type(), op);
|
|
compilation()->set_has_unsafe_access(true);
|
|
}
|
|
return InlineUnsafeOps;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) {
|
|
if (InlineUnsafeOps) {
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
null_check(args->at(0));
|
|
Instruction* offset = args->at(2);
|
|
#ifndef _LP64
|
|
offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
#endif
|
|
Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile));
|
|
compilation()->set_has_unsafe_access(true);
|
|
kill_all();
|
|
}
|
|
return InlineUnsafeOps;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) {
|
|
if (InlineUnsafeOps) {
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
null_check(args->at(0));
|
|
Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false));
|
|
push(op->type(), op);
|
|
compilation()->set_has_unsafe_access(true);
|
|
}
|
|
return InlineUnsafeOps;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) {
|
|
if (InlineUnsafeOps) {
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
null_check(args->at(0));
|
|
Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2)));
|
|
compilation()->set_has_unsafe_access(true);
|
|
}
|
|
return InlineUnsafeOps;
|
|
}
|
|
|
|
|
|
bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) {
|
|
if (InlineUnsafeOps) {
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
int obj_arg_index = 1; // Assume non-static case
|
|
if (is_static) {
|
|
obj_arg_index = 0;
|
|
} else {
|
|
null_check(args->at(0));
|
|
}
|
|
Instruction* offset = args->at(obj_arg_index + 1);
|
|
#ifndef _LP64
|
|
offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
#endif
|
|
Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset))
|
|
: append(new UnsafePrefetchRead (args->at(obj_arg_index), offset));
|
|
compilation()->set_has_unsafe_access(true);
|
|
}
|
|
return InlineUnsafeOps;
|
|
}
|
|
|
|
|
|
void GraphBuilder::append_unsafe_CAS(ciMethod* callee) {
|
|
ValueType* result_type = as_ValueType(callee->return_type());
|
|
assert(result_type->is_int(), "int result");
|
|
Values* args = state()->pop_arguments(callee->arg_size());
|
|
|
|
// Pop off some args to speically handle, then push back
|
|
Value newval = args->pop();
|
|
Value cmpval = args->pop();
|
|
Value offset = args->pop();
|
|
Value src = args->pop();
|
|
Value unsafe_obj = args->pop();
|
|
|
|
// Separately handle the unsafe arg. It is not needed for code
|
|
// generation, but must be null checked
|
|
null_check(unsafe_obj);
|
|
|
|
#ifndef _LP64
|
|
offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
#endif
|
|
|
|
args->push(src);
|
|
args->push(offset);
|
|
args->push(cmpval);
|
|
args->push(newval);
|
|
|
|
// An unsafe CAS can alias with other field accesses, but we don't
|
|
// know which ones so mark the state as no preserved. This will
|
|
// cause CSE to invalidate memory across it.
|
|
bool preserves_state = false;
|
|
Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, lock_stack(), preserves_state);
|
|
append_split(result);
|
|
push(result_type, result);
|
|
compilation()->set_has_unsafe_access(true);
|
|
}
|
|
|
|
|
|
#ifndef PRODUCT
|
|
void GraphBuilder::print_inline_result(ciMethod* callee, bool res) {
|
|
const char sync_char = callee->is_synchronized() ? 's' : ' ';
|
|
const char exception_char = callee->has_exception_handlers() ? '!' : ' ';
|
|
const char monitors_char = callee->has_monitor_bytecodes() ? 'm' : ' ';
|
|
tty->print(" %c%c%c ", sync_char, exception_char, monitors_char);
|
|
for (int i = 0; i < scope()->level(); i++) tty->print(" ");
|
|
if (res) {
|
|
tty->print(" ");
|
|
} else {
|
|
tty->print("- ");
|
|
}
|
|
tty->print("@ %d ", bci());
|
|
callee->print_short_name();
|
|
tty->print(" (%d bytes)", callee->code_size());
|
|
if (_inline_bailout_msg) {
|
|
tty->print(" %s", _inline_bailout_msg);
|
|
}
|
|
tty->cr();
|
|
|
|
if (res && CIPrintMethodCodes) {
|
|
callee->print_codes();
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::print_stats() {
|
|
vmap()->print();
|
|
}
|
|
#endif // PRODUCT
|
|
|
|
|
|
void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) {
|
|
append(new ProfileCall(method(), bci(), recv, known_holder));
|
|
}
|
|
|
|
|
|
void GraphBuilder::profile_invocation(ciMethod* callee) {
|
|
if (profile_calls()) {
|
|
// increment the interpreter_invocation_count for the inlinee
|
|
Value m = append(new Constant(new ObjectConstant(callee)));
|
|
append(new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1));
|
|
}
|
|
}
|
|
|
|
|
|
void GraphBuilder::profile_bci(int bci) {
|
|
if (profile_branches()) {
|
|
ciMethodData* md = method()->method_data();
|
|
if (md == NULL) {
|
|
BAILOUT("out of memory building methodDataOop");
|
|
}
|
|
ciProfileData* data = md->bci_to_data(bci);
|
|
assert(data != NULL && data->is_JumpData(), "need JumpData for goto");
|
|
Value mdo = append(new Constant(new ObjectConstant(md)));
|
|
append(new ProfileCounter(mdo, md->byte_offset_of_slot(data, JumpData::taken_offset()), 1));
|
|
}
|
|
}
|